1,4-di(5-phenoxymethyl-1,3,4-oxadiazol-2-yl)butane

ID: ALA192644

PubChem CID: 11418321

Max Phase: Preclinical

Molecular Formula: C22H22N4O4

Molecular Weight: 406.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(OCc2nnc(CCCCc3nnc(COc4ccccc4)o3)o2)cc1

Standard InChI:  InChI=1S/C22H22N4O4/c1-3-9-17(10-4-1)27-15-21-25-23-19(29-21)13-7-8-14-20-24-26-22(30-20)16-28-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2

Standard InChI Key:  WAZGKDJKJCJCIW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.0542   -2.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3125   -0.1667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292   -2.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1375   -0.1667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3042   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0625   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7250   -1.4417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6417   -0.8542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9750   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0167   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6583   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7292   -1.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3708   -0.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4500   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0833   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1125   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2542   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4417   -0.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1542   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7958   -0.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0875   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5417   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8250   -0.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1500    0.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5083   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8000   -2.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8667   -0.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8667   -0.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5208   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  4 10  2  0
  5  1  2  0
  6  7  1  0
  7 10  1  0
  8  5  1  0
  9  3  2  0
 10 17  1  0
 11  5  1  0
 12  6  1  0
 13 11  1  0
 14 12  1  0
 15 13  1  0
 16 14  1  0
 17 24  1  0
 18  9  1  0
 19 15  2  0
 20 15  1  0
 21 16  2  0
 22 16  1  0
 23 18  1  0
 24 23  1  0
 25 19  1  0
 26 21  1  0
 27 22  2  0
 28 20  2  0
 29 28  1  0
 30 27  1  0
  9  8  1  0
 29 25  2  0
  2  6  2  0
 30 26  2  0
M  END

Associated Targets(Human)

GPR182 Tbio Adrenomedullin receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.44Molecular Weight (Monoisotopic): 406.1641AlogP: 4.18#Rotatable Bonds: 11
Polar Surface Area: 96.30Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.37CX LogD: 2.37
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.77

References

1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A..  (2005)  Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin.,  48  (12): [PMID:15943480] [10.1021/jm050021+]

Source