N5,1-bis(4-aminophenyl)-N3-(2,3-dimethylphenyl)-1H-pyrazole-3,5-dicarboxamide

ID: ALA1940184

PubChem CID: 57327719

Max Phase: Preclinical

Molecular Formula: C25H24N6O2

Molecular Weight: 440.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)c2cc(C(=O)Nc3ccc(N)cc3)n(-c3ccc(N)cc3)n2)c1C

Standard InChI:  InChI=1S/C25H24N6O2/c1-15-4-3-5-21(16(15)2)29-24(32)22-14-23(25(33)28-19-10-6-17(26)7-11-19)31(30-22)20-12-8-18(27)9-13-20/h3-14H,26-27H2,1-2H3,(H,28,33)(H,29,32)

Standard InChI Key:  LYUNGAJJRPYZOS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    5.4592   -9.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2747  -10.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8803  -10.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6705  -10.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8518   -9.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2448   -9.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6390   -9.3255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2464   -9.8838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0335   -9.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0665  -10.6889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4864  -10.3094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6956  -10.1273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3679   -9.6493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1211   -8.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2961   -8.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6872  -10.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9671  -11.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9587  -12.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6696  -12.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3905  -12.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3954  -11.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6627  -13.4240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7099   -8.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5045   -8.5067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5048   -7.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0940   -7.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8882   -8.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4774   -7.5779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2724   -6.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4730   -6.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8873   -7.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0918   -8.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2719   -7.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  8 10  2  0
 20 21  2  0
 21 16  1  0
 12 16  1  0
  2  3  1  0
 19 22  1  0
  2 11  1  0
 14 23  1  0
  9 12  1  0
 23 24  1  0
  5  6  2  0
 23 25  2  0
  6  1  1  0
 24 26  1  0
  1  2  2  0
 26 27  2  0
  5  7  1  0
 27 28  1  0
 12 13  1  0
 28 29  2  0
 13 14  2  0
 29 30  1  0
 14 15  1  0
 30 31  2  0
 31 26  1  0
 15  9  2  0
 27 32  1  0
  3  4  2  0
 28 33  1  0
M  END

Associated Targets(Human)

SNU-449 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKT1 Tchem Serine/threonine-protein kinase AKT (9192 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 440.51Molecular Weight (Monoisotopic): 440.1961AlogP: 4.16#Rotatable Bonds: 5
Polar Surface Area: 128.06Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.87CX Basic pKa: 4.08CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.67

References

1. Strocchi E, Fornari F, Minguzzi M, Gramantieri L, Milazzo M, Rebuttini V, Breviglieri S, Camaggi CM, Locatelli E, Bolondi L, Comes-Franchini M..  (2012)  Design, synthesis and biological evaluation of pyrazole derivatives as potential multi-kinase inhibitors in hepatocellular carcinoma.,  48  [PMID:22227043] [10.1016/j.ejmech.2011.12.031]

Source