The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(3-chloropyridin-2-yl)piperazin-1-yl)((1S,2S,4R)-4-((R)-1-(4-methoxyphenyl)ethylamino)-2-(thiophen-3-yl)cyclohexyl)methanone ID: ALA1940358
PubChem CID: 57403427
Max Phase: Preclinical
Molecular Formula: C29H35ClN4O2S
Molecular Weight: 539.15
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H](C)N[C@@H]2CC[C@H](C(=O)N3CCN(c4ncccc4Cl)CC3)[C@@H](c3ccsc3)C2)cc1
Standard InChI: InChI=1S/C29H35ClN4O2S/c1-20(21-5-8-24(36-2)9-6-21)32-23-7-10-25(26(18-23)22-11-17-37-19-22)29(35)34-15-13-33(14-16-34)28-27(30)4-3-12-31-28/h3-6,8-9,11-12,17,19-20,23,25-26,32H,7,10,13-16,18H2,1-2H3/t20-,23-,25+,26-/m1/s1
Standard InChI Key: HMNNSMICNXFMLO-AAVWJAMMSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.4333 -6.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4333 -7.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1454 -7.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8574 -7.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8574 -6.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1454 -5.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5730 -5.9688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2863 -6.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0020 -5.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2839 -7.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7156 -6.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4307 -5.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4336 -5.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7153 -4.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0031 -5.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1487 -4.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8625 -5.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1449 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4775 -8.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7325 -9.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5575 -9.7073 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8123 -8.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7195 -7.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0044 -7.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7207 -8.4427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0009 -6.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2899 -5.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5736 -6.3766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5728 -7.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2883 -7.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8591 -5.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8624 -5.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1497 -4.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4334 -5.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4410 -5.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1473 -6.3686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5782 -4.7221 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
8 9 1 0
2 3 1 0
8 10 1 1
3 4 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 2 0
3 18 1 6
9 11 2 0
2 23 1 1
4 5 1 0
23 24 1 0
11 12 1 0
23 25 2 0
24 26 1 0
5 6 1 0
12 13 2 0
13 14 1 0
5 7 1 1
24 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
14 15 2 0
15 9 1 0
31 32 2 0
1 2 1 0
32 33 1 0
13 16 1 0
33 34 2 0
7 8 1 0
34 35 1 0
16 17 1 0
35 36 2 0
36 31 1 0
28 31 1 0
18 19 1 0
32 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.15Molecular Weight (Monoisotopic): 538.2169AlogP: 5.76#Rotatable Bonds: 7Polar Surface Area: 57.70Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.51CX LogP: 5.37CX LogD: 3.29Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.36
References 1. Anthony Romero F, Hastings NB, Moningka R, Guo Z, Wang M, Di Salvo J, Lei Y, Trusca D, Deng Q, Tong V, Terebetski JL, Ball RG, Ujjainwalla F.. (2012) The discovery of potent antagonists of NPBWR1 (GPR7)., 22 (2): [PMID:22197390 ] [10.1016/j.bmcl.2011.11.126 ]