The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(1H-benzo[d]imidazol-2-yl)piperazin-1-yl)((1S,2S,4R)-4-((R)-1-(4-methoxyphenyl)ethylamino)-2-(thiophen-3-yl)cyclohexyl)methanone ID: ALA1940369
PubChem CID: 57393081
Max Phase: Preclinical
Molecular Formula: C31H37N5O2S
Molecular Weight: 543.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H](C)N[C@@H]2CC[C@H](C(=O)N3CCN(c4nc5ccccc5[nH]4)CC3)[C@@H](c3ccsc3)C2)cc1
Standard InChI: InChI=1S/C31H37N5O2S/c1-21(22-7-10-25(38-2)11-8-22)32-24-9-12-26(27(19-24)23-13-18-39-20-23)30(37)35-14-16-36(17-15-35)31-33-28-5-3-4-6-29(28)34-31/h3-8,10-11,13,18,20-21,24,26-27,32H,9,12,14-17,19H2,1-2H3,(H,33,34)/t21-,24-,26+,27-/m1/s1
Standard InChI Key: APRPXBJRNYTSIL-UFLJZRJVSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
1.0958 -7.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0958 -8.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8079 -8.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5199 -8.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5199 -7.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8079 -6.7958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2355 -6.8021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9488 -7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6645 -6.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9464 -8.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3781 -7.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0932 -6.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0961 -5.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3778 -5.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6656 -5.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8112 -5.5796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5250 -5.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8074 -9.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1400 -9.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3950 -10.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2200 -10.5407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4748 -9.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3820 -8.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3331 -8.0396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3832 -9.2760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3366 -7.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0476 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7639 -7.2100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7647 -8.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0492 -8.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4784 -6.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5644 -5.9691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2412 -7.1251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7915 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3719 -5.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7822 -5.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6119 -5.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0296 -5.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6169 -6.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
8 10 1 1
3 4 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 2 0
3 18 1 6
9 11 2 0
2 23 1 1
4 5 1 0
23 24 1 0
11 12 1 0
23 25 2 0
24 26 1 0
5 6 1 0
12 13 2 0
13 14 1 0
5 7 1 1
24 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
14 15 2 0
28 31 1 0
31 32 1 0
15 9 1 0
1 2 1 0
32 35 1 0
34 33 1 0
33 31 2 0
13 16 1 0
7 8 1 0
34 35 2 0
16 17 1 0
35 36 1 0
18 19 1 0
36 37 2 0
1 6 1 0
37 38 1 0
8 9 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.74Molecular Weight (Monoisotopic): 543.2668AlogP: 5.58#Rotatable Bonds: 7Polar Surface Area: 73.49Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.29CX Basic pKa: 9.51CX LogP: 5.36CX LogD: 3.26Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.32Np Likeness Score: -1.28
References 1. Anthony Romero F, Hastings NB, Moningka R, Guo Z, Wang M, Di Salvo J, Lei Y, Trusca D, Deng Q, Tong V, Terebetski JL, Ball RG, Ujjainwalla F.. (2012) The discovery of potent antagonists of NPBWR1 (GPR7)., 22 (2): [PMID:22197390 ] [10.1016/j.bmcl.2011.11.126 ]