(4-(5-chloropyridin-2-yl)piperazin-1-yl)((1S,2S,4R)-4-(2-(4-nitrophenyl)propan-2-ylamino)-2-(thiophen-3-yl)cyclohexyl)methanone

ID: ALA1940532

PubChem CID: 57401831

Max Phase: Preclinical

Molecular Formula: C29H34ClN5O3S

Molecular Weight: 568.14

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(N[C@@H]1CC[C@H](C(=O)N2CCN(c3ccc(Cl)cn3)CC2)[C@@H](c2ccsc2)C1)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C29H34ClN5O3S/c1-29(2,21-3-7-24(8-4-21)35(37)38)32-23-6-9-25(26(17-23)20-11-16-39-19-20)28(36)34-14-12-33(13-15-34)27-10-5-22(30)18-31-27/h3-5,7-8,10-11,16,18-19,23,25-26,32H,6,9,12-15,17H2,1-2H3/t23-,25+,26-/m1/s1

Standard InChI Key:  IKVCHAXHNNREHP-DMTNHVFBSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   31.8291  -25.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9792  -25.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9792  -26.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6912  -27.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4032  -26.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4032  -25.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6912  -25.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1189  -25.4604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5478  -25.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2614  -25.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9766  -25.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9794  -24.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2612  -24.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5489  -24.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6908  -27.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0234  -28.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2783  -29.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1034  -29.1990    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.3582  -28.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2653  -27.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5502  -26.6979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2665  -27.9344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5467  -25.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8357  -25.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1194  -25.8683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1186  -26.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8342  -27.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4050  -25.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4082  -24.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6956  -24.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9792  -24.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9868  -25.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6931  -25.8603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2634  -24.2104    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.6950  -24.2347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6964  -23.4097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4088  -24.6484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4083  -26.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2333  -26.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 19 15  2  0
  4 15  1  6
  2  7  1  0
  3 20  1  1
  9 10  2  0
 20 21  1  0
  3  4  1  0
 20 22  2  0
 21 23  1  0
 10 11  1  0
  4  5  1  0
 11 12  2  0
  5  6  1  0
 12 13  1  0
 21 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  6  7  1  0
 13 14  2  0
 28 29  2  0
 14  9  1  0
 29 30  1  0
 15 16  1  0
 30 31  2  0
 31 32  1  0
  6  8  1  1
 32 33  2  0
 33 28  1  0
 25 28  1  0
  8  1  1  0
 31 34  1  0
  2  3  1  0
  1  9  1  0
 16 17  2  0
 35 36  2  0
 35 37  1  0
 12 35  1  0
 17 18  1  0
  1 38  1  0
 18 19  1  0
  1 39  1  0
M  CHG  2  35   1  37  -1
M  END

Associated Targets(non-human)

Npbwr1 Neuropeptides B/W receptor type 1 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.14Molecular Weight (Monoisotopic): 567.2071AlogP: 5.83#Rotatable Bonds: 7
Polar Surface Area: 91.61Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.22CX LogP: 5.75CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.79

References

1. Anthony Romero F, Hastings NB, Moningka R, Guo Z, Wang M, Di Salvo J, Lei Y, Trusca D, Deng Q, Tong V, Terebetski JL, Ball RG, Ujjainwalla F..  (2012)  The discovery of potent antagonists of NPBWR1 (GPR7).,  22  (2): [PMID:22197390] [10.1016/j.bmcl.2011.11.126]

Source