(4-(5-chloropyridin-2-yl)piperazin-1-yl)((1S,2S,4R)-2-(thiophen-3-yl)-4-(2-p-tolylpropan-2-ylamino)cyclohexyl)methanone

ID: ALA1940535

PubChem CID: 57396581

Max Phase: Preclinical

Molecular Formula: C30H37ClN4OS

Molecular Weight: 537.17

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(C)(C)N[C@@H]2CC[C@H](C(=O)N3CCN(c4ccc(Cl)cn4)CC3)[C@@H](c3ccsc3)C2)cc1

Standard InChI:  InChI=1S/C30H37ClN4OS/c1-21-4-6-23(7-5-21)30(2,3)33-25-9-10-26(27(18-25)22-12-17-37-20-22)29(36)35-15-13-34(14-16-35)28-11-8-24(31)19-32-28/h4-8,11-12,17,19-20,25-27,33H,9-10,13-16,18H2,1-3H3/t25-,26+,27-/m1/s1

Standard InChI Key:  VQKCCZVESKKTGU-KWXIBIRDSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   30.1167    0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1167   -0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8287   -0.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5407   -0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5407    0.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8287    0.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2564    0.8646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9696    0.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6853    0.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3989    0.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1141    0.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1169    1.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3987    2.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6864    1.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8283   -1.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1609   -2.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4158   -2.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2409   -2.8740    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.4957   -2.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4028   -0.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6877   -0.3729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4040   -1.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6842    0.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9732    0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2569    0.4567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2561   -0.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9717   -0.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5425    0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5457    1.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8331    2.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1167    1.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1243    0.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8306    0.4647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4009    2.1146    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.5500   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3750   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8321    2.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
 18 19  1  0
 19 15  2  0
  3 15  1  6
  2  3  1  0
  2 20  1  1
  9 10  2  0
 20 21  1  0
  3  4  1  0
 20 22  2  0
 21 23  1  0
 10 11  1  0
  4  5  1  0
 11 12  2  0
  5  6  1  0
 12 13  1  0
 21 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 13 14  2  0
 28 29  2  0
 14  9  1  0
 29 30  1  0
 15 16  1  0
 30 31  2  0
  5  7  1  1
 31 32  1  0
  1  2  1  0
 32 33  2  0
 33 28  1  0
 25 28  1  0
  7  8  1  0
 31 34  1  0
  1  6  1  0
  8 35  1  0
  8  9  1  0
  8 36  1  0
 16 17  2  0
 12 37  1  0
M  END

Associated Targets(non-human)

Npbwr1 Neuropeptides B/W receptor type 1 (82 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.17Molecular Weight (Monoisotopic): 536.2377AlogP: 6.23#Rotatable Bonds: 6
Polar Surface Area: 48.47Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.73CX LogP: 6.32CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.69

References

1. Anthony Romero F, Hastings NB, Moningka R, Guo Z, Wang M, Di Salvo J, Lei Y, Trusca D, Deng Q, Tong V, Terebetski JL, Ball RG, Ujjainwalla F..  (2012)  The discovery of potent antagonists of NPBWR1 (GPR7).,  22  (2): [PMID:22197390] [10.1016/j.bmcl.2011.11.126]

Source