The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-Oxo-9-[N'-(2-phenoxy-acetyl)-hydrazino]-nonanoic acid N'-(2-phenoxy-acetyl)-hydrazide ID: ALA194287
PubChem CID: 4507818
Max Phase: Preclinical
Molecular Formula: C25H32N4O6
Molecular Weight: 484.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCCCC(=O)NNC(=O)COc1ccccc1)NNC(=O)COc1ccccc1
Standard InChI: InChI=1S/C25H32N4O6/c30-22(26-28-24(32)18-34-20-12-6-4-7-13-20)16-10-2-1-3-11-17-23(31)27-29-25(33)19-35-21-14-8-5-9-15-21/h4-9,12-15H,1-3,10-11,16-19H2,(H,26,30)(H,27,31)(H,28,32)(H,29,33)
Standard InChI Key: CXYLSHRKQPKDEH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
9.8292 -2.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1750 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 -2.0667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -2.1042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6875 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -2.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4000 -2.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1833 -3.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8292 -3.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6792 -1.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -1.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8875 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6000 -2.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2542 -2.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9750 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3208 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -2.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9750 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6792 -2.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0250 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3125 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -2.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -2.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0250 -0.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4000 -2.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6792 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4000 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 7 1 0
5 8 1 0
6 19 1 0
7 6 1 0
8 3 1 0
9 2 2 0
10 1 2 0
11 5 2 0
12 6 2 0
13 1 1 0
14 2 1 0
15 14 1 0
16 13 1 0
17 16 1 0
18 15 1 0
19 26 1 0
20 5 1 0
21 17 2 0
22 17 1 0
23 18 2 0
24 18 1 0
25 20 1 0
26 28 1 0
27 25 1 0
28 29 1 0
29 27 1 0
30 23 1 0
31 24 2 0
32 21 1 0
33 22 2 0
34 31 1 0
35 33 1 0
35 32 2 0
34 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.55Molecular Weight (Monoisotopic): 484.2322AlogP: 2.17#Rotatable Bonds: 14Polar Surface Area: 134.86Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.17CX Basic pKa: ┄CX LogP: 2.07CX LogD: 2.06Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -0.67
References 1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A.. (2005) Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin., 48 (12): [PMID:15943480 ] [10.1021/jm050021+ ]