1-{3-Methyl-5-[4-(5-trifluoromethyl-[1,2,4]oxadiazol-3-yl)-phenoxy]-pentyl}-3-pyridin-4-yl-imidazolidin-2-one

ID: ALA194340

PubChem CID: 5278487

Max Phase: Preclinical

Molecular Formula: C23H24F3N5O3

Molecular Weight: 475.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CCOc1ccc(-c2noc(C(F)(F)F)n2)cc1)CCN1CCN(c2ccncc2)C1=O

Standard InChI:  InChI=1S/C23H24F3N5O3/c1-16(8-12-30-13-14-31(22(30)32)18-6-10-27-11-7-18)9-15-33-19-4-2-17(3-5-19)20-28-21(34-29-20)23(24,25)26/h2-7,10-11,16H,8-9,12-15H2,1H3

Standard InChI Key:  QWQAMULOAWDCJZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   10.3250   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167   -1.6292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1667   -4.7917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4417   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1917   -2.7875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6542   -0.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -4.1167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7417   -2.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7792   -5.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -4.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7292   -2.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0792   -3.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4917   -4.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0292   -3.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2500   -5.3250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9542   -0.0125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4167   -1.0292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9292   -0.3042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0042   -2.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7292   -3.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3042   -3.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -4.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1125   -5.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3000   -2.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0167   -4.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -4.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5917   -4.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8792   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0000   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542   -3.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1667   -4.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4542   -2.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  8  1  0
  4  3  1  0
  5  2  1  0
  6  9  1  0
  7  1  1  0
  8 15  1  0
  9  1  1  0
 10 14  1  0
 11  4  1  0
 12  5  1  0
 13  3  2  0
 14  8  1  0
 15 27  1  0
 16 31  1  0
 17  7  1  0
 18  7  1  0
 19  7  1  0
 20 12  1  0
 21 12  2  0
 22 26  2  0
 23 11  2  0
 24 11  1  0
 25 20  2  0
 26 21  1  0
 27 32  1  0
 28 22  1  0
 29 28  1  0
 30 23  1  0
 31 24  2  0
 32 33  1  0
 33 29  1  0
 34 32  1  0
  5  6  2  0
 25 22  1  0
  4 10  1  0
 30 16  2  0
M  END

Associated Targets(non-human)

Enterovirus (1116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 475.47Molecular Weight (Monoisotopic): 475.1831AlogP: 4.89#Rotatable Bonds: 9
Polar Surface Area: 84.59Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.48CX LogP: 4.26CX LogD: 4.26
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -1.41

References

1. Chang CS, Lin YT, Shih SR, Lee CC, Lee YC, Tai CL, Tseng SN, Chern JH..  (2005)  Design, synthesis, and antipicornavirus activity of 1-[5-(4-arylphenoxy)alkyl]-3-pyridin-4-ylimidazolidin-2-one derivatives.,  48  (10): [PMID:15887961] [10.1021/jm050033v]

Source