The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-4-(3,7-dimethyl-3-vinylocta-1,6-dienyl)phenyl octanoate ID: ALA1946503
PubChem CID: 57382642
Max Phase: Preclinical
Molecular Formula: C26H38O2
Molecular Weight: 382.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@@](C)(/C=C/c1ccc(OC(=O)CCCCCCC)cc1)CCC=C(C)C
Standard InChI: InChI=1S/C26H38O2/c1-6-8-9-10-11-14-25(27)28-24-17-15-23(16-18-24)19-21-26(5,7-2)20-12-13-22(3)4/h7,13,15-19,21H,2,6,8-12,14,20H2,1,3-5H3/b21-19+/t26-/m1/s1
Standard InChI Key: BKRLMOAQDKQAPN-MLBYCOPISA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
5.3944 -3.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3932 -4.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1081 -4.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8245 -4.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8216 -3.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1063 -3.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6784 -4.6851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5346 -3.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2506 -3.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9635 -3.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6795 -3.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6826 -4.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9697 -4.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9728 -5.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2599 -5.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6888 -5.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5458 -2.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3893 -2.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2142 -2.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9643 -4.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2495 -4.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9650 -3.4470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5354 -4.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5360 -3.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8219 -3.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1071 -3.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1064 -4.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8206 -4.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13 14 2 0
2 7 1 0
14 15 1 0
3 4 2 0
14 16 1 0
5 8 1 0
10 17 1 0
10 18 1 6
8 9 2 0
18 19 2 0
4 5 1 0
7 20 1 0
9 10 1 0
20 21 1 0
2 3 1 0
20 22 2 0
10 11 1 0
21 23 1 0
5 6 2 0
23 24 1 0
11 12 1 0
24 25 1 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 1 0
1 2 2 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.59Molecular Weight (Monoisotopic): 382.2872AlogP: 7.90#Rotatable Bonds: 13Polar Surface Area: 26.30Molecular Species: ┄HBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.46CX LogD: 8.46Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.15Np Likeness Score: 1.13
References 1. Majeed R, Reddy MV, Chinthakindi PK, Sangwan PL, Hamid A, Chashoo G, Saxena AK, Koul S.. (2012) Bakuchiol derivatives as novel and potent cytotoxic agents: a report., 49 [PMID:22245048 ] [10.1016/j.ejmech.2011.12.018 ]