The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Hydroxy-N-[(2,3,5,6-tetrafluoro-4'-(trifluoromethyl))biphenyl-4-yl]-1,2,5-oxadiazole-3-carboxamide ID: ALA1946849
PubChem CID: 57381530
Max Phase: Preclinical
Molecular Formula: C16H6F7N3O3
Molecular Weight: 421.23
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1c(F)c(F)c(-c2ccc(C(F)(F)F)cc2)c(F)c1F)c1nonc1O
Standard InChI: InChI=1S/C16H6F7N3O3/c17-8-7(5-1-3-6(4-2-5)16(21,22)23)9(18)11(20)12(10(8)19)24-14(27)13-15(28)26-29-25-13/h1-4H,(H,24,27)(H,26,28)
Standard InChI Key: LIJULCBDFNNLRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-1.5806 -17.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5818 -18.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8669 -18.6360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1505 -18.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1534 -17.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8687 -16.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2966 -18.6351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0107 -18.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7255 -18.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0100 -17.3970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4998 -18.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0078 -18.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5464 -19.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7534 -19.4543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7254 -17.5541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5565 -16.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2728 -17.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9852 -16.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9826 -16.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2615 -15.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5521 -16.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6949 -15.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4115 -16.1421 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.6907 -14.9083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -15.3125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8671 -19.4610 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.5646 -18.6341 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.2952 -16.9835 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8712 -16.1580 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14 9 2 0
2 7 1 0
11 15 1 0
3 4 2 0
7 8 1 0
16 17 2 0
17 18 1 0
8 9 1 0
18 19 2 0
4 5 1 0
19 20 1 0
8 10 2 0
20 21 2 0
21 16 1 0
5 16 1 0
9 11 1 0
19 22 1 0
2 3 1 0
22 23 1 0
5 6 2 0
22 24 1 0
6 1 1 0
22 25 1 0
1 2 2 0
3 26 1 0
11 12 2 0
4 27 1 0
12 13 1 0
1 28 1 0
13 14 1 0
6 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.23Molecular Weight (Monoisotopic): 421.0297AlogP: 4.27#Rotatable Bonds: 3Polar Surface Area: 88.25Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.37CX Basic pKa: ┄CX LogP: 4.43CX LogD: 2.57Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.18
References 1. Lolli ML, Giorgis M, Tosco P, Foti A, Fruttero R, Gasco A.. (2012) New inhibitors of dihydroorotate dehydrogenase (DHODH) based on the 4-hydroxy-1,2,5-oxadiazol-3-yl (hydroxyfurazanyl) scaffold., 49 [PMID:22245049 ] [10.1016/j.ejmech.2011.12.038 ]