The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Trans-ethyl 3-(2-((S)-1-((S)-2-acetamidobutanoyl)pyrrolidine-2-carbonyl)-1-(2-amino-2-oxoethyl)hydrazinecarbonyl)oxirane-2-carboxylate ID: ALA1950282
PubChem CID: 57398022
Max Phase: Preclinical
Molecular Formula: C19H29N5O8
Molecular Weight: 455.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1OC1C(=O)N(CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC)NC(C)=O
Standard InChI: InChI=1S/C19H29N5O8/c1-4-11(21-10(3)25)17(28)23-8-6-7-12(23)16(27)22-24(9-13(20)26)18(29)14-15(32-14)19(30)31-5-2/h11-12,14-15H,4-9H2,1-3H3,(H2,20,26)(H,21,25)(H,22,27)/t11-,12-,14?,15?/m0/s1
Standard InChI Key: RKUQFNRGTWIVKQ-XOEAPDPESA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
14.9792 -26.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8042 -26.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0616 -25.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3917 -25.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7266 -25.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7783 -25.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3904 -24.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1043 -24.1989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7828 -24.6900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4905 -25.9314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2074 -25.5229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9194 -25.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1894 -24.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8947 -24.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8768 -23.4454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6180 -24.6670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9150 -26.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0651 -25.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7773 -25.9546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4940 -25.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2062 -25.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0695 -24.7133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6753 -24.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3484 -25.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6380 -25.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3500 -25.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6741 -23.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9590 -22.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9615 -24.6147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2464 -24.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5325 -24.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2451 -23.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14 16 2 0
7 8 2 0
12 17 2 0
25 12 1 0
3 4 1 0
24 18 1 0
6 9 2 0
18 19 1 0
4 5 1 0
19 20 1 0
6 10 1 0
20 21 1 0
5 1 1 0
18 22 2 0
10 11 1 0
23 7 1 0
25 24 1 0
1 2 1 0
11 12 1 0
3 6 1 6
25 26 1 0
24 26 1 0
11 13 1 0
23 27 1 0
27 28 1 0
13 14 1 0
23 29 1 1
4 7 1 0
29 30 1 0
14 15 1 0
30 31 1 0
2 3 1 0
30 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.47Molecular Weight (Monoisotopic): 455.2016AlogP: -2.43#Rotatable Bonds: 9Polar Surface Area: 180.74Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.18CX Basic pKa: ┄CX LogP: -2.94CX LogD: -2.94Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: -0.45
References 1. Lee J, Bogyo M.. (2012) Synthesis and evaluation of aza-peptidyl inhibitors of the lysosomal asparaginyl endopeptidase, legumain., 22 (3): [PMID:22243962 ] [10.1016/j.bmcl.2011.12.079 ]