1,6-di(5-phenoxymethyl-1,3,4-oxadiazol-2-yl)hexane

ID: ALA195133

PubChem CID: 11259075

Max Phase: Preclinical

Molecular Formula: C24H26N4O4

Molecular Weight: 434.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(OCc2nnc(CCCCCCc3nnc(COc4ccccc4)o3)o2)cc1

Standard InChI:  InChI=1S/C24H26N4O4/c1(9-15-21-25-27-23(31-21)17-29-19-11-5-3-6-12-19)2-10-16-22-26-28-24(32-22)18-30-20-13-7-4-8-14-20/h3-8,11-14H,1-2,9-10,15-18H2

Standard InChI Key:  OBFXTUSSRDHANK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    9.0792   -2.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9042   -0.5667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -2.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7292   -0.5667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3292   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -1.8375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6667   -1.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0000   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9917   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0417   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -1.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7542   -1.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2292   -1.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4667   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4875   -1.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042   -1.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2792   -1.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4667   -0.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1958   -1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4958   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1792   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -1.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4167   -1.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1375   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8542   -1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083   -2.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8917   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1750   -0.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9125   -1.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8917   -0.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9208   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  4 10  2  0
  5  1  2  0
  6  7  1  0
  7 10  1  0
  8  5  1  0
  9  3  2  0
 10 17  1  0
 11  5  1  0
 12  6  1  0
 13 11  1  0
 14 12  1  0
 15 13  1  0
 16 14  1  0
 17 24  1  0
 18  9  1  0
 19 15  2  0
 20 16  2  0
 21 16  1  0
 22 15  1  0
 23 18  1  0
 24 25  1  0
 25 26  1  0
 26 23  1  0
 27 21  2  0
 28 22  2  0
 29 19  1  0
 30 20  1  0
 31 28  1  0
 32 27  1  0
  9  8  1  0
 31 29  2  0
  2  6  2  0
 32 30  2  0
M  END

Associated Targets(Human)

GPR182 Tbio Adrenomedullin receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.50Molecular Weight (Monoisotopic): 434.1954AlogP: 4.96#Rotatable Bonds: 13
Polar Surface Area: 96.30Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.69

References

1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A..  (2005)  Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin.,  48  (12): [PMID:15943480] [10.1021/jm050021+]

Source