The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Oxo-6-[N'-(2-phenoxy-acetyl)-hydrazino]-hexanoic acid N'-(2-phenoxy-acetyl)-hydrazide ID: ALA195258
PubChem CID: 3113773
Max Phase: Preclinical
Molecular Formula: C22H26N4O6
Molecular Weight: 442.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCC(=O)NNC(=O)COc1ccccc1)NNC(=O)COc1ccccc1
Standard InChI: InChI=1S/C22H26N4O6/c27-19(23-25-21(29)15-31-17-9-3-1-4-10-17)13-7-8-14-20(28)24-26-22(30)16-32-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,23,27)(H,24,28)(H,25,29)(H,26,30)
Standard InChI Key: JRJOEGZZOWPWDI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
0.5667 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4292 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7167 -0.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2875 -0.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -0.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -0.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5667 -1.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4375 0.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7125 0.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2875 -1.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1458 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1500 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8583 -0.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8625 -0.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5708 -0.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5792 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5750 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -0.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5708 0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2833 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2875 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5750 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1417 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8625 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2875 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2833 0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9958 -0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0042 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9958 0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0042 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 8 1 0
4 1 1 0
5 7 1 0
6 19 1 0
7 4 1 0
8 6 1 0
9 1 2 0
10 2 2 0
11 5 2 0
12 6 2 0
13 1 1 0
14 2 1 0
15 13 1 0
16 14 1 0
17 15 1 0
18 16 1 0
19 26 1 0
20 5 1 0
21 17 1 0
22 17 2 0
23 18 2 0
24 18 1 0
25 20 1 0
26 25 1 0
27 24 2 0
28 21 2 0
29 22 1 0
30 23 1 0
31 29 2 0
32 27 1 0
31 28 1 0
32 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.47Molecular Weight (Monoisotopic): 442.1852AlogP: 1.00#Rotatable Bonds: 11Polar Surface Area: 134.86Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.90CX Basic pKa: ┄CX LogP: 0.73CX LogD: 0.73Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.77
References 1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A.. (2005) Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin., 48 (12): [PMID:15943480 ] [10.1021/jm050021+ ] 2. PubChem BioAssay data set,