The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Oxo-8-[N'-(2-phenoxy-acetyl)-hydrazino]-octanoic acid N'-(2-phenoxy-acetyl)-hydrazide ID: ALA195275
PubChem CID: 11420013
Max Phase: Preclinical
Molecular Formula: C24H30N4O6
Molecular Weight: 470.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCCC(=O)NNC(=O)COc1ccccc1)NNC(=O)COc1ccccc1
Standard InChI: InChI=1S/C24H30N4O6/c29-21(25-27-23(31)17-33-19-11-5-3-6-12-19)15-9-1-2-10-16-22(30)26-28-24(32)18-34-20-13-7-4-8-14-20/h3-8,11-14H,1-2,9-10,15-18H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32)
Standard InChI Key: NARZHMQOGSVBOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
9.1167 -2.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1750 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4042 -2.4875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -2.1042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9750 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -2.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6875 -2.0750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1833 -3.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9667 -3.3125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -1.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8292 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8875 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6000 -2.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5417 -2.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2625 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3208 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -2.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -2.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -2.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2542 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0250 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3125 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4000 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1167 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8292 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -3.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -2.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0250 -0.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6875 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6875 -3.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7458 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 7 1 0
5 8 1 0
6 19 1 0
7 6 1 0
8 3 1 0
9 2 2 0
10 1 2 0
11 5 2 0
12 6 2 0
13 1 1 0
14 2 1 0
15 14 1 0
16 13 1 0
17 16 1 0
18 15 1 0
19 26 1 0
20 5 1 0
21 17 2 0
22 17 1 0
23 18 2 0
24 18 1 0
25 20 1 0
26 27 1 0
27 28 1 0
28 25 1 0
29 22 2 0
30 23 1 0
31 24 2 0
32 21 1 0
33 29 1 0
34 31 1 0
33 32 2 0
34 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.2165AlogP: 1.78#Rotatable Bonds: 13Polar Surface Area: 134.86Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.00CX Basic pKa: ┄CX LogP: 1.62CX LogD: 1.62Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.69
References 1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A.. (2005) Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin., 48 (12): [PMID:15943480 ] [10.1021/jm050021+ ]