8-Oxo-8-[N'-(2-phenoxy-acetyl)-hydrazino]-octanoic acid N'-(2-phenoxy-acetyl)-hydrazide

ID: ALA195275

PubChem CID: 11420013

Max Phase: Preclinical

Molecular Formula: C24H30N4O6

Molecular Weight: 470.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCCCCC(=O)NNC(=O)COc1ccccc1)NNC(=O)COc1ccccc1

Standard InChI:  InChI=1S/C24H30N4O6/c29-21(25-27-23(31)17-33-19-11-5-3-6-12-19)15-9-1-2-10-16-22(30)26-28-24(32)18-34-20-13-7-4-8-14-20/h3-8,11-14H,1-2,9-10,15-18H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32)

Standard InChI Key:  NARZHMQOGSVBOJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    9.1167   -2.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1750   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4042   -2.4875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417   -2.1042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9750   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2542   -2.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6875   -2.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1833   -3.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1167   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9667   -3.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9667   -1.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8292   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8875   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6000   -2.5167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5417   -2.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2625   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3208   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6875   -2.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2542   -2.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9667   -2.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2542   -3.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0250   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3125   -1.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5417   -2.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4000   -2.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8292   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9667   -3.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7458   -2.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0250   -0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6875   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6875   -3.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7458   -1.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  3  1  1  0
  4  7  1  0
  5  8  1  0
  6 19  1  0
  7  6  1  0
  8  3  1  0
  9  2  2  0
 10  1  2  0
 11  5  2  0
 12  6  2  0
 13  1  1  0
 14  2  1  0
 15 14  1  0
 16 13  1  0
 17 16  1  0
 18 15  1  0
 19 26  1  0
 20  5  1  0
 21 17  2  0
 22 17  1  0
 23 18  2  0
 24 18  1  0
 25 20  1  0
 26 27  1  0
 27 28  1  0
 28 25  1  0
 29 22  2  0
 30 23  1  0
 31 24  2  0
 32 21  1  0
 33 29  1  0
 34 31  1  0
 33 32  2  0
 34 30  2  0
M  END

Alternative Forms

Associated Targets(Human)

GPR182 Tbio Adrenomedullin receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.2165AlogP: 1.78#Rotatable Bonds: 13
Polar Surface Area: 134.86Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.00CX Basic pKa: CX LogP: 1.62CX LogD: 1.62
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.69

References

1. García MA, Martín-Santamaría S, Cacho M, de la Llave FM, Julián M, Martínez A, de Pascual-Teresa B, Ramos A..  (2005)  Synthesis, biological evaluation, and three-dimensional quantitative structure-activity relationship study of small-molecule positive modulators of adrenomedullin.,  48  (12): [PMID:15943480] [10.1021/jm050021+]

Source