The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-[2-(Benzyl-butyl-amino)-ethyl]-2,3-dimethoxy-12H-8,10-dioxa-6,12-diaza-cyclopenta[b]chrysen-13-one ID: ALA195611
PubChem CID: 11238021
Max Phase: Preclinical
Molecular Formula: C32H33N3O5
Molecular Weight: 539.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(=O)n(CCN(Cc3ccccc3)C(C)(C)C)c3c4cc5c(cc4ncc3c2cc1OC)OCO5
Standard InChI: InChI=1S/C32H33N3O5/c1-32(2,3)34(18-20-9-7-6-8-10-20)11-12-35-30-23-15-28-29(40-19-39-28)16-25(23)33-17-24(30)21-13-26(37-4)27(38-5)14-22(21)31(35)36/h6-10,13-17H,11-12,18-19H2,1-5H3
Standard InChI Key: JXLPQNBZAHZTEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
-0.4333 0.1625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4333 0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 -0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8583 0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8583 0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4333 2.6458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 2.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 -1.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2958 0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2958 0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -1.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 1.1500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 2.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -1.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 1.4208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 -0.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4292 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 -0.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1292 -1.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7333 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7333 0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4167 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 6 1 0
6 3 1 0
7 2 1 0
8 7 2 0
9 7 1 0
10 5 2 0
11 6 2 0
12 8 1 0
13 4 1 0
14 1 1 0
15 8 1 0
16 9 2 0
17 16 1 0
18 25 1 0
19 20 2 0
20 11 1 0
21 3 2 0
22 18 1 0
23 16 1 0
24 17 1 0
25 14 1 0
26 23 1 0
27 18 1 0
28 19 1 0
29 20 1 0
30 27 1 0
31 22 1 0
32 22 1 0
33 22 1 0
34 30 2 0
35 30 1 0
36 28 1 0
37 29 1 0
38 34 1 0
39 35 2 0
40 39 1 0
5 4 1 0
12 13 2 0
19 10 1 0
17 15 2 0
26 24 1 0
40 38 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.63Molecular Weight (Monoisotopic): 539.2420AlogP: 5.75#Rotatable Bonds: 7Polar Surface Area: 75.05Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.93CX LogP: 4.87CX LogD: 3.33Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.48
References 1. Ruchelman AL, Houghton PJ, Zhou N, Liu A, Liu LF, LaVoie EJ.. (2005) 5-(2-aminoethyl)dibenzo[c,h][1,6]naphthyridin-6-ones: variation of n-alkyl substituents modulates sensitivity to efflux transporters associated with multidrug resistance., 48 (3): [PMID:15689163 ] [10.1021/jm049447z ] 2. Zhou W, Dai Z, Chen Y, Yuan Z. (2013) Computational QSAR models with high-dimensional descriptor selection improve antitumor activity design of ARC-111 analogues, 22 (1): [10.1007/s00044-012-0034-x ]