5-(8-(4-morpholinophenylamino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)isoindolin-1-one

ID: ALA1956682

PubChem CID: 57345529

Max Phase: Preclinical

Molecular Formula: C23H21N7O2

Molecular Weight: 427.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NCc2cc(-c3cnc(Nc4ccc(N5CCOCC5)cc4)c4ncnn34)ccc21

Standard InChI:  InChI=1S/C23H21N7O2/c31-23-19-6-1-15(11-16(19)12-25-23)20-13-24-21(22-26-14-27-30(20)22)28-17-2-4-18(5-3-17)29-7-9-32-10-8-29/h1-6,11,13-14H,7-10,12H2,(H,24,28)(H,25,31)

Standard InChI Key:  ZDLDULHTZCUMMG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
    1.4773   -1.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1950   -1.3668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1921   -0.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4755   -0.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7612   -1.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7625   -0.5368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0268   -0.2791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5160   -0.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0289   -1.6225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4771   -2.6073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1871   -3.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1839   -3.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8932   -4.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6046   -3.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6025   -3.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8927   -2.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3207   -4.2524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3187   -5.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0305   -5.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7484   -5.0786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7498   -4.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0333   -3.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4737    0.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1876    1.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7518    1.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7568    1.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4690    2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1864    1.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8021    2.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4651    3.2474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6413    3.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0883    3.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
 15 16  2  0
 16 11  1  0
  6  7  1  0
 14 17  1  0
 17 18  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  4  6  1  0
  1 10  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
  4 23  1  0
 10 11  1  0
 23 24  2  0
 24 28  1  0
  1  2  2  0
 27 25  1  0
 11 12  2  0
 25 26  2  0
 26 23  1  0
 27 28  2  0
  5  1  1  0
 12 13  1  0
  2  3  1  0
 13 14  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 14 15  1  0
 31 32  2  0
M  END

Associated Targets(Human)

MAPKAPK5 Tchem MAP kinase-activated protein kinase 5 (2831 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.47Molecular Weight (Monoisotopic): 427.1757AlogP: 2.61#Rotatable Bonds: 4
Polar Surface Area: 96.68Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.24CX Basic pKa: 2.37CX LogP: 2.26CX LogD: 2.26
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.37

References

1. Andrews MJ, Clase JA, Bar G, Tricarico G, Edwards PJ, Brys R, Chambers M, Schmidt W, MacLeod A, Hirst K, Allen V, Birault V, Le J, Harris J, Self A, Nash K, Dixon G..  (2012)  Discovery of a series of imidazopyrazine small molecule inhibitors of the kinase MAPKAPK5, that show activity using in vitro and in vivo models of rheumatoid arthritis.,  22  (6): [PMID:22342143] [10.1016/j.bmcl.2012.01.077]

Source