The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(2-hydroxy-3-(4-p-tolylpiperazin-1-yl)propoxy)phenyl)-3-phenylpropan-1-one ID: ALA1963594
PubChem CID: 56647652
Max Phase: Preclinical
Molecular Formula: C29H34N2O3
Molecular Weight: 458.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(N2CCN(CC(O)COc3ccccc3C(=O)CCc3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C29H34N2O3/c1-23-11-14-25(15-12-23)31-19-17-30(18-20-31)21-26(32)22-34-29-10-6-5-9-27(29)28(33)16-13-24-7-3-2-4-8-24/h2-12,14-15,26,32H,13,16-22H2,1H3
Standard InChI Key: ZJYHULVNOMALBG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
8.1527 -6.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1516 -7.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8664 -7.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5828 -7.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5800 -6.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8646 -6.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2929 -6.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0089 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2898 -5.3978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7218 -6.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4378 -6.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4378 -7.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1530 -7.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8669 -7.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8611 -6.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1454 -6.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2980 -7.8799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2992 -8.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0144 -9.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0157 -9.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7282 -8.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7308 -10.3527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7283 -11.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4393 -11.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1556 -11.1769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1563 -10.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4407 -9.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8692 -11.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8621 -12.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5748 -12.8276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2912 -12.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2903 -11.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5770 -11.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0053 -12.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
4 17 1 0
17 18 1 0
7 9 2 0
18 19 1 0
4 5 1 0
19 20 1 0
8 10 1 0
19 21 1 0
2 3 1 0
20 22 1 0
22 23 1 0
10 11 1 0
5 6 2 0
11 12 2 0
6 1 1 0
12 13 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
1 2 2 0
25 28 1 0
13 14 2 0
28 29 2 0
5 7 1 0
29 30 1 0
14 15 1 0
30 31 2 0
3 4 2 0
31 32 1 0
15 16 2 0
32 33 2 0
33 28 1 0
16 11 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.60Molecular Weight (Monoisotopic): 458.2569AlogP: 4.37#Rotatable Bonds: 10Polar Surface Area: 53.01Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.80CX LogP: 5.29CX LogD: 5.20Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -0.97
References 1. Lowes D, Pradhan A, Iyer LV, Parman T, Gow J, Zhu F, Furimsky A, Lemoff A, Guiguemde WA, Sigal M, Clark JA, Wilson E, Tang L, Connelly MC, Derisi JL, Kyle DE, Mirsalis J, Guy RK.. (2012) Lead optimization of antimalarial propafenone analogues., 55 (13): [PMID:22708838 ] [10.1021/jm300286a ]