(1S,3S,7S,10R,11S,12S,16R)-16-Fluoromethyl-7,11-dihydroxy-8,8,10,12-tetramethyl-3-[(E)-1-methyl-2-(2-methyl-thiazol-4-yl)-vinyl]-4,17-dioxa-bicyclo[14.1.0]heptadecane-5,9-dione

ID: ALA196415

PubChem CID: 9849744

Max Phase: Preclinical

Molecular Formula: C27H40FNO6S

Molecular Weight: 525.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\c1csc(C)n1)[C@@H]1C[C@@H]2O[C@]2(CF)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1

Standard InChI:  InChI=1S/C27H40FNO6S/c1-15-8-7-9-27(14-28)22(35-27)11-20(16(2)10-19-13-36-18(4)29-19)34-23(31)12-21(30)26(5,6)25(33)17(3)24(15)32/h10,13,15,17,20-22,24,30,32H,7-9,11-12,14H2,1-6H3/b16-10+/t15-,17+,20-,21-,22-,24-,27-/m0/s1

Standard InChI Key:  HRNVVEIJGCCCNC-VMPXBVPOSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  1  0  0  0  0  0999 V2000
    1.0875    0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917    0.5083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0500   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7583   -2.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4542   -1.3500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8000   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -2.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0875   -2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9417   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2250   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7583   -1.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8917   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3750   -0.0167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.6042   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -3.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7917   -3.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0500   -1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3667    0.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4750   -1.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -3.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9250   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2417   -1.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5583   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5792    1.3083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2250   -0.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375    0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7167   -0.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -0.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3375   -1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8000   -0.3167    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  0
  4  6  1  0
  5  4  1  0
  6 17  1  0
  7  9  1  0
  8 10  1  0
  9 15  1  0
 10 11  1  0
 11 13  1  0
 12 14  1  0
 13  3  1  0
 14  8  1  0
 15 16  2  0
 11 16  1  1
 17 23  1  0
 18  7  2  0
 19 20  1  0
 20  9  2  0
 21  4  2  0
 22  8  2  0
 23 35  1  0
  1 24  1  6
 25  1  1  0
 17 26  1  1
 12 27  1  6
  5 28  1  0
  5 29  1  0
  6 30  1  6
 31 24  1  0
 32 16  1  0
 33 25  1  0
 34 18  1  0
 35 33  1  0
 23 36  1  6
  3  2  1  0
 12  5  1  0
 18 19  1  0
  3 37  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

1A9 (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-10 (150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-22 (54 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TUBB4B Tclin Tubulin beta-2 chain (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.68Molecular Weight (Monoisotopic): 525.2560AlogP: 4.43#Rotatable Bonds: 3
Polar Surface Area: 109.25Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.73CX LogP: 3.97CX LogD: 3.97
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: 1.93

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]
2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source