(1S,3S,10R,11S,12S,16R)-11-Hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-methyl-2-(2-methylsulfanyl-thiazol-4-yl)-vinyl]-4-oxa-bicyclo[14.1.0]heptadecane-5,9-dione

ID: ALA196498

PubChem CID: 44403679

Max Phase: Preclinical

Molecular Formula: C28H43NO4S2

Molecular Weight: 521.79

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSc1nc(/C=C(\C)[C@@H]2C[C@@H]3C[C@@]3(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)CCC(=O)O2)cs1

Standard InChI:  InChI=1S/C28H43NO4S2/c1-17-9-8-11-28(6)15-20(28)14-22(18(2)13-21-16-35-26(29-21)34-7)33-23(30)10-12-27(4,5)25(32)19(3)24(17)31/h13,16-17,19-20,22,24,31H,8-12,14-15H2,1-7H3/b18-13+/t17-,19+,20+,22-,24-,28+/m0/s1

Standard InChI Key:  RWCGFGVAZCRLSQ-OWYYKWNWSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  1  0  0  0  0  0999 V2000
    0.7167    0.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4250   -0.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0792   -0.4750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250    1.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5167    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -1.5042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0000    0.8583    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667   -0.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4333    0.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7208   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167   -0.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2292    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167   -2.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3417    0.2708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125    0.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167    1.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458    0.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0542    1.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1458   -0.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7208   -2.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5458   -1.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0042    2.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125    1.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8000   -0.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4250    0.5633    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 14  1  0
  4  8  1  0
  5  3  1  0
  1  6  1  0
  7  4  2  0
  8 12  1  0
  9 10  1  0
 10 16  1  0
 11 18  1  0
 12 13  2  0
 10 13  1  1
 14 23  1  0
 15  5  1  0
 16  2  1  0
 17  9  1  0
 18  8  2  0
 19  5  2  0
 20 17  2  0
 21 24  1  0
 22  7  1  0
 23 33  1  0
 24 17  1  0
 25  1  1  0
 14 26  1  1
  1 27  1  1
  3 28  1  6
 29 13  1  0
 15 30  1  0
 15 31  1  0
 32 25  1  0
 33 32  1  0
 23 34  1  6
 35 22  1  0
  2  6  1  0
 21 15  1  0
  7 11  1  0
  2 36  1  6
M  END

Associated Targets(Human)

1A9 (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-10 (150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
1A9/ptx-22 (54 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.79Molecular Weight (Monoisotopic): 521.2634AlogP: 6.79#Rotatable Bonds: 3
Polar Surface Area: 76.49Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 0.85CX LogP: 7.44CX LogD: 7.44
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: 1.46

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]
2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source