The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103905304 ID: ALA1966143
PubChem CID: 90660907
Max Phase: Preclinical
Molecular Formula: C24H18N4O4
Molecular Weight: 426.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1=Cc1c(C)cc2nc3ccccc3n2c1O
Standard InChI: InChI=1S/C24H18N4O4/c1-13-11-21-25-19-5-3-4-6-20(19)27(21)22(29)17(13)12-18-14(2)26-28(23(18)30)16-9-7-15(8-10-16)24(31)32/h3-12,29H,1-2H3,(H,31,32)
Standard InChI Key: CIYPTMSDKNRLGL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.6435 1.9817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5913 2.8397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0742 2.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4930 3.7694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3464 0.5840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9339 -0.6855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3920 1.6067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2205 0.7997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6014 -0.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5214 0.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8985 1.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7054 1.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2665 -0.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0645 1.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9604 0.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4084 -0.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6775 2.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2575 1.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4000 0.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9694 1.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1457 1.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4595 -0.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1624 1.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7674 0.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0925 0.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2319 2.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8131 1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2285 -0.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6530 2.6134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9856 3.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5668 1.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4067 2.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
2 17 2 0
3 32 2 0
4 32 1 0
5 9 1 0
5 10 1 0
5 11 1 0
6 9 2 0
6 13 1 0
7 8 1 0
7 17 1 0
7 21 1 0
8 19 2 0
9 16 1 0
10 13 1 0
10 20 2 0
11 12 2 0
12 15 1 0
18 12 1 0
13 22 2 0
14 17 1 0
14 18 2 3
14 19 1 0
15 16 2 0
15 24 1 0
19 28 1 0
20 23 1 0
21 26 2 0
21 27 1 0
22 25 1 0
23 25 2 0
26 30 1 0
27 31 2 0
29 30 2 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.43Molecular Weight (Monoisotopic): 426.1328AlogP: 4.01#Rotatable Bonds: 3Polar Surface Area: 107.50Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.98CX Basic pKa: 5.92CX LogP: 2.21CX LogD: 0.86Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.21
References 1. PubChem BioAssay data set,