{6-[(Diphenylcarbamoyloxy)-methyl]-7,8-dihydro-naphthalen-1-yloxy}-acetic acid

ID: ALA196935

PubChem CID: 19082464

Max Phase: Preclinical

Molecular Formula: C26H23NO5

Molecular Weight: 429.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)COc1cccc2c1CCC(COC(=O)N(c1ccccc1)c1ccccc1)=C2

Standard InChI:  InChI=1S/C26H23NO5/c28-25(29)18-31-24-13-7-8-20-16-19(14-15-23(20)24)17-32-26(30)27(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-13,16H,14-15,17-18H2,(H,28,29)

Standard InChI Key:  ZSJIPPDUEJOCNN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    6.0042    1.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7250    1.1333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4417    1.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1500    1.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4417    0.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8667    1.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2917    1.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1542   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125   -2.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042    2.3708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -0.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7292    0.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4375    1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -2.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8667    0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5792    1.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125   -1.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -2.6125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250    1.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125    1.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0125    0.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4417   -0.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1500    1.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4292    2.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -0.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8625    1.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1375    2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4500   -0.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8542    2.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7375   -1.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  6  2  0
  5  8  1  0
  6 17  1  0
  7  1  1  0
  8 16  1  0
  9 18  1  0
 10  5  2  0
 11  1  2  0
 12 10  1  0
 13  2  1  0
 14  2  1  0
 15  9  2  0
 16  6  1  0
 17  7  1  0
 18 12  1  0
 19  9  1  0
 20  3  2  0
 21 20  1  0
 22 10  1  0
 23 13  1  0
 24 14  2  0
 25 14  1  0
 26 13  2  0
 27 24  1  0
 28 25  2  0
 29 26  1  0
 30 23  2  0
 31 28  1  0
 32 29  2  0
 27 31  2  0
 30 32  1  0
  3  5  1  0
 21 22  2  0
M  END

Associated Targets(Human)

Cell line (371 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.47Molecular Weight (Monoisotopic): 429.1576AlogP: 5.45#Rotatable Bonds: 7
Polar Surface Area: 76.07Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.73CX Basic pKa: CX LogP: 5.30CX LogD: 2.01
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.15

References

1. Hattori K, Tanaka A, Okitsu O, Tabuchi S, Taniguchi K, Nishio M, Koyama S, Higaki M, Seki J, Sakane K..  (2005)  Discovery of diphenylcarbamate derivatives as highly potent and selective IP receptor agonists: orally active prostacyclin mimetics. Part 3.,  15  (12): [PMID:15914004] [10.1016/j.bmcl.2005.04.047]

Source