The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID99454257 ID: ALA1971582
PubChem CID: 41962431
Max Phase: Preclinical
Molecular Formula: C24H24N2O5S
Molecular Weight: 452.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)c1ccc(OCC(=O)OCc2csc(CC(=O)Nc3ccccc3C)n2)cc1
Standard InChI: InChI=1S/C24H24N2O5S/c1-3-21(27)17-8-10-19(11-9-17)30-14-24(29)31-13-18-15-32-23(25-18)12-22(28)26-20-7-5-4-6-16(20)2/h4-11,15H,3,12-14H2,1-2H3,(H,26,28)
Standard InChI Key: BXVLANDCTXRKQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-5.3810 -1.8782 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.6464 -2.1557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5030 -2.5682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6095 -0.9913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9319 -3.3932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3549 -0.0932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1616 -1.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4601 0.4298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9685 -1.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0753 -2.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3041 -0.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8290 -2.4913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1246 -0.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2806 0.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3609 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6404 -1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2115 -2.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7655 -0.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6404 -2.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9260 -0.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9319 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9260 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2115 -1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3549 -0.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6162 1.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2174 -2.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5860 -0.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4366 1.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9216 0.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4300 -0.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0694 -1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7839 -0.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 12 1 0
2 15 1 0
2 21 1 0
3 17 1 0
3 26 1 0
4 13 2 0
5 21 2 0
6 24 2 0
7 9 2 0
7 10 1 0
8 13 1 0
8 14 1 0
9 11 1 0
10 12 2 0
10 15 1 0
11 13 1 0
14 18 1 0
14 25 2 0
16 19 2 0
16 20 1 0
16 24 1 0
17 22 2 0
17 23 1 0
18 27 2 0
18 30 1 0
19 22 1 0
20 23 2 0
21 26 1 0
24 31 1 0
25 28 1 0
27 29 1 0
28 29 2 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.53Molecular Weight (Monoisotopic): 452.1406AlogP: 4.35#Rotatable Bonds: 10Polar Surface Area: 94.59Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.33CX LogP: 4.13CX LogD: 4.13Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.84
References 1. PubChem BioAssay data set,