SID85200831

ID: ALA1974650

PubChem CID: 44201953

Max Phase: Preclinical

Molecular Formula: C31H46N2O7

Molecular Weight: 558.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)C[C@H]1C/C=C\C[C@H](CC(=O)N[C@@H](CO)Cc2ccccc2)C(=O)N[C@H](C(C)(C)C)COC1=O

Standard InChI:  InChI=1S/C31H46N2O7/c1-30(2,3)25-20-39-29(38)23(18-27(36)40-31(4,5)6)15-11-10-14-22(28(37)33-25)17-26(35)32-24(19-34)16-21-12-8-7-9-13-21/h7-13,22-25,34H,14-20H2,1-6H3,(H,32,35)(H,33,37)/b11-10-/t22-,23-,24-,25+/m1/s1

Standard InChI Key:  CFKXLZMHZOCZAV-DFWHHEQISA-N

Molfile:  

     RDKit          2D

 40 41  0  0  1  0  0  0  0  0999 V2000
   -3.2538    0.1470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6038    3.0049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6038   -2.7109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2538   -1.2819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0462    1.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413   -1.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8712    1.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413    2.2904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0462    3.0049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2538    1.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0788    1.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0163    2.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6038    1.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413    0.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0163   -0.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8413   -0.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1913    2.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7788    1.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3663    2.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6038   -1.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6038    0.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0163   -1.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9038    1.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0788    0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0788    2.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3663    0.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8712    3.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7788    0.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0163   -3.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2837    3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1087    3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2837    2.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5212    4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5212    3.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4288   -4.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3018   -3.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7308   -3.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3462    4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3462    3.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7587    3.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 14  1  0
  1 16  1  0
  2 12  2  0
  3 22  1  0
  3 29  1  0
  4 16  2  0
  5 19  2  0
  6 22  2  0
  7 32  1  0
  8 10  1  0
  8 12  1  0
  9 19  1  0
 27  9  1  6
 10 11  1  1
 10 14  1  0
 11 23  1  0
 11 24  1  0
 11 25  1  0
 12 13  1  0
 13 17  1  6
 13 18  1  0
 15 16  1  0
 15 20  1  6
 15 21  1  0
 17 19  1  0
 18 26  1  0
 20 22  1  0
 21 28  1  0
 26 28  2  0
 27 30  1  0
 27 32  1  0
 29 35  1  0
 29 36  1  0
 29 37  1  0
 30 31  1  0
 31 33  2  0
 31 34  1  0
 33 38  1  0
 34 39  2  0
 38 40  2  0
 39 40  1  0
M  END

Associated Targets(Human)

GMNN Tbio Geminin (128009 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TDP1 Tchem Tyrosyl-DNA phosphodiesterase 1 (345557 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
APEX1 Tchem DNA-(apurinic or apyrimidinic site) lyase (38016 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Phosphoglycerate kinase, glycosomal (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.72Molecular Weight (Monoisotopic): 558.3305AlogP: 3.48#Rotatable Bonds: 8
Polar Surface Area: 131.03Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 3.43CX LogD: 3.43
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: 0.33

References

1. PubChem BioAssay data set, 

Source

Source(1):