The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103073845 ID: ALA1977120
PubChem CID: 5164803
Max Phase: Preclinical
Molecular Formula: C27H26ClN3O5S
Molecular Weight: 540.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCN1CCOCC1)c1ccc2c(c1)N(Cc1cccc(Cl)c1)C(=O)c1ccccc1S2(=O)=O
Standard InChI: InChI=1S/C27H26ClN3O5S/c28-21-5-3-4-19(16-21)18-31-23-17-20(26(32)29-10-11-30-12-14-36-15-13-30)8-9-25(23)37(34,35)24-7-2-1-6-22(24)27(31)33/h1-9,16-17H,10-15,18H2,(H,29,32)
Standard InChI Key: BMGBJQVDJRVUNW-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-1.4245 -3.3844 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.9814 2.0160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4670 2.6610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4958 2.6610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7518 -0.5346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3105 0.1242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6022 5.2681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5689 0.2087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7317 1.4897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9693 3.6595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2381 1.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0545 0.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7247 1.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9083 0.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3939 0.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2662 0.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6333 2.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3386 1.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3295 2.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2109 -0.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6966 0.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1550 1.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1178 1.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1269 0.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6757 -1.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3014 1.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3177 -1.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4984 -1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7825 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9631 -1.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6052 -2.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5481 2.2940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1529 2.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5741 4.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1810 3.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3905 5.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9974 4.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 29 1 0
2 3 2 0
2 4 2 0
2 11 1 0
2 13 1 0
5 15 2 0
6 24 2 0
7 36 1 0
7 37 1 0
8 12 1 0
8 15 1 0
8 20 1 0
9 24 1 0
9 32 1 0
10 33 1 0
10 34 1 0
10 35 1 0
11 12 1 0
11 17 2 0
12 16 2 0
13 14 1 0
13 19 2 0
14 15 1 0
14 21 2 0
16 18 1 0
17 22 1 0
18 22 2 0
18 24 1 0
19 23 1 0
20 25 1 0
21 26 1 0
23 26 2 0
25 27 2 0
25 28 1 0
27 29 1 0
28 30 2 0
29 31 2 0
30 31 1 0
32 33 1 0
34 36 1 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.04Molecular Weight (Monoisotopic): 539.1282AlogP: 3.40#Rotatable Bonds: 6Polar Surface Area: 96.02Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.69CX Basic pKa: 4.52CX LogP: 3.11CX LogD: 3.11Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.95
References 1. PubChem BioAssay data set,