SID103073845

ID: ALA1977120

PubChem CID: 5164803

Max Phase: Preclinical

Molecular Formula: C27H26ClN3O5S

Molecular Weight: 540.04

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCN1CCOCC1)c1ccc2c(c1)N(Cc1cccc(Cl)c1)C(=O)c1ccccc1S2(=O)=O

Standard InChI:  InChI=1S/C27H26ClN3O5S/c28-21-5-3-4-19(16-21)18-31-23-17-20(26(32)29-10-11-30-12-14-36-15-13-30)8-9-25(23)37(34,35)24-7-2-1-6-22(24)27(31)33/h1-9,16-17H,10-15,18H2,(H,29,32)

Standard InChI Key:  BMGBJQVDJRVUNW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -1.4245   -3.3844    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.9814    2.0160    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4670    2.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4958    2.6610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7518   -0.5346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3105    0.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6022    5.2681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5689    0.2087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7317    1.4897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9693    3.6595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2381    1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0545    0.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7247    1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9083    0.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3939    0.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2662    0.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6333    2.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3386    1.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3295    2.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2109   -0.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6966    0.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1550    1.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1178    1.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1269    0.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6757   -1.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3014    1.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3177   -1.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7825   -2.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9631   -1.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6052   -2.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5481    2.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1529    2.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5741    4.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1810    3.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3905    5.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9974    4.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 29  1  0
  2  3  2  0
  2  4  2  0
  2 11  1  0
  2 13  1  0
  5 15  2  0
  6 24  2  0
  7 36  1  0
  7 37  1  0
  8 12  1  0
  8 15  1  0
  8 20  1  0
  9 24  1  0
  9 32  1  0
 10 33  1  0
 10 34  1  0
 10 35  1  0
 11 12  1  0
 11 17  2  0
 12 16  2  0
 13 14  1  0
 13 19  2  0
 14 15  1  0
 14 21  2  0
 16 18  1  0
 17 22  1  0
 18 22  2  0
 18 24  1  0
 19 23  1  0
 20 25  1  0
 21 26  1  0
 23 26  2  0
 25 27  2  0
 25 28  1  0
 27 29  1  0
 28 30  2  0
 29 31  2  0
 30 31  1  0
 32 33  1  0
 34 36  1  0
 35 37  1  0
M  END

Associated Targets(Human)

TDP1 Tchem Tyrosyl-DNA phosphodiesterase 1 (345557 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Phosphoglycerate kinase, glycosomal (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.04Molecular Weight (Monoisotopic): 539.1282AlogP: 3.40#Rotatable Bonds: 6
Polar Surface Area: 96.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.69CX Basic pKa: 4.52CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.95

References

1. PubChem BioAssay data set, 

Source

Source(1):