The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103904392 ID: ALA1978601
PubChem CID: 49830391
Max Phase: Preclinical
Molecular Formula: C26H20FN5O2
Molecular Weight: 453.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(F)c(NC(=O)Nc2ccc(-c3coc4c(-c5cccnc5)cnc(N)c34)cc2)c1
Standard InChI: InChI=1S/C26H20FN5O2/c1-15-4-9-21(27)22(11-15)32-26(33)31-18-7-5-16(6-8-18)20-14-34-24-19(13-30-25(28)23(20)24)17-3-2-10-29-12-17/h2-14H,1H3,(H2,28,30)(H2,31,32,33)
Standard InChI Key: WPTLPMIQIGYRNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.7478 -3.3376 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1435 2.1904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1957 -2.7246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 1.1104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3556 -0.1271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1633 -2.2830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 4.4104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8662 -3.6807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6411 1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6411 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1435 0.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3556 2.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3556 0.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3984 0.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6284 1.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3556 3.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 1.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1536 -0.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2054 -0.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 3.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6411 3.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9083 -1.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1014 -1.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4604 -0.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6411 4.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3141 -4.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6112 -2.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3556 4.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4928 -4.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5691 -5.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0170 -5.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0449 -4.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7899 -5.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2720 -6.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 29 1 0
2 10 1 0
2 15 1 0
3 27 2 0
4 13 1 0
4 17 2 0
5 13 1 0
6 22 1 0
6 27 1 0
7 20 2 0
7 28 1 0
8 26 1 0
8 27 1 0
9 10 1 0
9 11 1 0
9 13 2 0
10 12 2 0
11 14 1 0
11 15 2 0
12 16 1 0
12 17 1 0
14 18 2 0
14 19 1 0
16 20 1 0
16 21 2 0
18 23 1 0
19 24 2 0
21 25 1 0
22 23 2 0
22 24 1 0
25 28 2 0
26 29 1 0
26 30 2 0
29 32 2 0
30 31 1 0
31 33 2 0
31 34 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.48Molecular Weight (Monoisotopic): 453.1601AlogP: 6.23#Rotatable Bonds: 4Polar Surface Area: 106.07Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.40CX Basic pKa: 5.31CX LogP: 4.56CX LogD: 4.55Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.26
References 1. PubChem BioAssay data set,