The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49648844 ID: ALA1980844
PubChem CID: 56642849
Max Phase: Preclinical
Molecular Formula: C16H17N5O8S2
Molecular Weight: 453.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N/OCC(=O)O)c3csc(N)n3)[C@H]2SC1.O
Standard InChI: InChI=1S/C16H15N5O7S2.H2O/c1-2-6-4-29-14-10(13(25)21(14)11(6)15(26)27)19-12(24)9(20-28-3-8(22)23)7-5-30-16(17)18-7;/h2,5,10,14H,1,3-4H2,(H2,17,18)(H,19,24)(H,22,23)(H,26,27);1H2/b20-9+;/t10-,14-;/m1./s1
Standard InChI Key: HPRLWADTNARROR-AAUIGXPGSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
6.6584 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2757 0.1193 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.3574 0.5163 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.1528 -1.7016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9901 -2.7682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5612 -2.7682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8576 -0.7203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5973 2.0403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7536 4.2174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7640 3.2070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5612 -1.1182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1528 0.2902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0139 1.4569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3200 -0.3237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6630 -0.9217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5612 -0.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7362 -0.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7362 -1.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2757 -1.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9901 -1.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2757 -2.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9901 -0.2932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6441 0.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7046 -1.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0243 0.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6655 0.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1438 -0.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4191 -1.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3837 2.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9671 3.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3024 0.6727 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16 2 1 0
2 22 1 0
3 27 1 0
3 28 1 0
4 18 2 0
5 21 2 0
6 21 1 0
7 23 2 0
8 13 1 0
8 30 1 0
9 31 2 0
10 31 1 0
11 16 1 0
11 18 1 0
11 19 1 0
17 12 1 1
12 23 1 0
13 24 2 0
14 26 1 0
14 28 2 0
15 28 1 0
16 17 1 0
17 18 1 0
19 20 2 0
19 21 1 0
20 22 1 0
20 25 1 0
23 24 1 0
24 26 1 0
25 29 2 0
26 27 2 0
30 31 1 0
16 32 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.0413AlogP: -0.54#Rotatable Bonds: 8Polar Surface Area: 184.51Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.62CX Basic pKa: 3.95CX LogP: -1.28CX LogD: -7.13Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.23Np Likeness Score: -0.05
References 1. PubChem BioAssay data set,