The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID103905537 ID: ALA1985690
PubChem CID: 49831003
Max Phase: Preclinical
Molecular Formula: C27H32N4O3S2
Molecular Weight: 524.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOc1ccc(C(C)(C)CC)cc1S(=O)(=O)Nc1ccc(-c2csc3ncnc(N)c23)cc1
Standard InChI: InChI=1S/C27H32N4O3S2/c1-5-7-14-34-22-13-10-19(27(3,4)6-2)15-23(22)36(32,33)31-20-11-8-18(9-12-20)21-16-35-26-24(21)25(28)29-17-30-26/h8-13,15-17,31H,5-7,14H2,1-4H3,(H2,28,29,30)
Standard InChI Key: KNWWRJAPDGOPBT-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-1.2523 4.8315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7846 -0.2549 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.6393 4.2795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8654 5.3836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7622 6.4008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8044 4.2184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 -0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7846 1.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7003 5.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0396 1.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9553 6.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6587 5.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1067 5.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2695 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5494 3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4657 5.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8465 2.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4875 2.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4032 6.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4038 6.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1015 2.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7425 3.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4289 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2726 5.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6372 6.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2941 4.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0172 7.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5276 4.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8241 7.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0791 8.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8860 8.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 6 1 0
1 12 1 0
2 13 1 0
2 19 1 0
5 15 1 0
5 32 1 0
6 20 1 0
7 13 2 0
7 28 1 0
8 17 1 0
8 28 2 0
9 17 1 0
10 11 1 0
10 13 1 0
10 17 2 0
11 14 1 0
11 19 2 0
12 15 1 0
12 18 2 0
14 22 2 0
14 23 1 0
15 24 2 0
16 18 1 0
16 21 1 0
16 25 2 0
20 26 2 0
20 27 1 0
21 29 1 0
21 30 1 0
21 31 1 0
22 26 1 0
23 27 2 0
24 25 1 0
29 33 1 0
32 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.71Molecular Weight (Monoisotopic): 524.1916AlogP: 6.61#Rotatable Bonds: 10Polar Surface Area: 107.20Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.01CX Basic pKa: 4.08CX LogP: 6.35CX LogD: 5.92Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.55
References 1. PubChem BioAssay data set,