SID99456154

ID: ALA1999427

PubChem CID: 23603047

Max Phase: Preclinical

Molecular Formula: C20H18F3N3O5S

Molecular Weight: 469.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)CCC(=O)Nc3ccccc3C(F)(F)F)ccc21

Standard InChI:  InChI=1S/C20H18F3N3O5S/c1-25-15-8-7-12(11-16(15)26(2)19(29)18(25)28)32(30,31)10-9-17(27)24-14-6-4-3-5-13(14)20(21,22)23/h3-8,11H,9-10H2,1-2H3,(H,24,27)

Standard InChI Key:  YKMAFFQKZUUZRY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    1.3115   -2.1818    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5983   -0.5318    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4233   -1.3568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7733   -1.3568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9753   -2.1818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9753   -0.5318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7240   -1.4673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8990   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4549   -3.4193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5464   -2.1818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5464   -0.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1694   -2.1818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8319   -1.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8319   -0.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5970   -1.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2609   -1.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2609   -0.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1175   -2.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1175   -0.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5970   -0.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0260   -2.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5983   -2.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5464   -3.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8838   -2.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5464    0.2932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5983   -1.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7404   -2.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4549   -2.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3128   -2.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8838   -3.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3128   -3.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5983   -3.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  7  2  0
  1  8  2  0
  1 15  1  0
  1 21  1  0
  2 26  1  0
  3 26  1  0
  4 26  1  0
  5 16  2  0
  6 17  2  0
  9 28  2  0
 10 13  1  0
 10 16  1  0
 10 23  1  0
 11 14  1  0
 11 17  1  0
 11 25  1  0
 12 24  1  0
 12 28  1  0
 13 14  1  0
 13 18  2  0
 14 19  2  0
 15 18  1  0
 15 20  2  0
 16 17  1  0
 19 20  1  0
 21 27  1  0
 22 24  1  0
 22 26  1  0
 22 29  2  0
 24 30  2  0
 27 28  1  0
 29 31  1  0
 30 32  1  0
 31 32  2  0
M  END

Associated Targets(Human)

GNAS Tbio Guanine nucleotide-binding protein G(s), subunit alpha (103405 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Phosphoglycerate kinase, glycosomal (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.44Molecular Weight (Monoisotopic): 469.0919AlogP: 2.06#Rotatable Bonds: 5
Polar Surface Area: 107.24Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.76CX Basic pKa: CX LogP: 1.38CX LogD: 1.38
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.74

References

1. PubChem BioAssay data set, 

Source

Source(1):