The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24405564 ID: ALA2000203
PubChem CID: 16027085
Max Phase: Preclinical
Molecular Formula: C25H30N4O4S
Molecular Weight: 482.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)C1CCC(Cn2c(=O)c3sccc3n(CC(=O)Nc3cc(C)cc(C)c3)c2=O)CC1
Standard InChI: InChI=1S/C25H30N4O4S/c1-15-10-16(2)12-19(11-15)27-21(30)14-28-20-8-9-34-22(20)24(32)29(25(28)33)13-17-4-6-18(7-5-17)23(31)26-3/h8-12,17-18H,4-7,13-14H2,1-3H3,(H,26,31)(H,27,30)
Standard InChI Key: XQNMPYLBGPTMQX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-3.5239 0.9511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.0248 1.9337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5959 -0.5413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4538 -1.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2620 -1.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0248 -0.5413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3104 0.6962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7393 -2.6038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9765 -0.1288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7393 -0.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7393 0.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0248 1.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3104 -0.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5239 -0.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0248 -1.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5959 1.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0088 0.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1186 0.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7393 -1.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8331 1.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1186 -0.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4538 -3.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5475 -0.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5475 0.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8331 -0.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4538 -3.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1682 -2.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2620 -0.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1682 -4.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8827 -3.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8827 -3.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1682 -5.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5972 -2.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9765 0.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
1 17 1 0
2 12 2 0
3 13 2 0
4 19 2 0
5 28 2 0
6 10 1 0
6 13 1 0
6 15 1 0
7 12 1 0
7 13 1 0
7 16 1 0
8 19 1 0
8 22 1 0
9 28 1 0
9 34 1 0
10 11 2 0
10 14 1 0
11 12 1 0
14 17 2 0
15 19 1 0
16 18 1 0
18 20 1 0
18 21 1 0
20 24 1 0
21 25 1 0
22 26 2 0
22 27 1 0
23 24 1 0
23 25 1 0
23 28 1 0
26 29 1 0
27 30 2 0
29 31 2 0
29 32 1 0
30 31 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.61Molecular Weight (Monoisotopic): 482.1988AlogP: 3.03#Rotatable Bonds: 6Polar Surface Area: 102.20Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.24CX Basic pKa: ┄CX LogP: 3.44CX LogD: 3.44Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.95
References 1. PubChem BioAssay data set,