The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID99456115 ID: ALA2006707
PubChem CID: 46943621
Max Phase: Preclinical
Molecular Formula: C25H25N3O4
Molecular Weight: 431.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(CNC(=O)C2(C)Cc3c(-c4ccc5c(c4)OCO5)ccnc3O2)cc1
Standard InChI: InChI=1S/C25H25N3O4/c1-25(24(29)27-14-16-4-7-18(8-5-16)28(2)3)13-20-19(10-11-26-23(20)32-25)17-6-9-21-22(12-17)31-15-30-21/h4-12H,13-15H2,1-3H3,(H,27,29)
Standard InChI Key: NYGDBNRGCITMCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.1716 -2.1437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2994 0.0584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0526 -3.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2994 1.3933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0576 -0.9242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6237 -3.4598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2599 -5.9048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3511 -2.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6287 -0.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3431 -1.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6287 -0.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0156 -1.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9142 0.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3425 -3.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3431 0.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1997 -0.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5148 0.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6410 -2.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0576 -0.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5148 1.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9142 1.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1997 1.5508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 0.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6151 -4.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1037 -4.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1123 -5.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8138 -4.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5412 -5.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8311 -5.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5325 -4.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2686 -6.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9700 -5.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 8 1 0
1 10 1 0
2 17 1 0
2 23 1 0
3 14 2 0
4 20 1 0
4 23 1 0
5 10 1 0
5 19 2 0
6 14 1 0
6 24 1 0
7 28 1 0
7 31 1 0
7 32 1 0
8 12 1 0
8 14 1 0
8 18 1 0
9 10 2 0
9 11 1 0
9 12 1 0
11 13 1 0
11 15 2 0
13 16 1 0
13 21 2 0
15 19 1 0
16 17 2 0
17 20 1 0
20 22 2 0
21 22 1 0
24 25 1 0
25 26 2 0
25 27 1 0
26 29 1 0
27 30 2 0
28 29 2 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1845AlogP: 3.55#Rotatable Bonds: 5Polar Surface Area: 72.92Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.27CX Basic pKa: 4.86CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -0.46
References 1. PubChem BioAssay data set,