The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Phosphoric acid benzyl ester 6-methyl-5,13-dioxo-5,6,11,13-tetrahydro-11a-aza-dibenzo[b,h]fluoren-1-yl ester ID: ALA2009105
Cas Number: 114517-04-3
PubChem CID: 71328
Max Phase: Phase
Molecular Formula: C28H22NO6P
Molecular Weight: 499.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: GR 63178K | GR-63178K | Fosquidone|114517-02-1|GR 63178K|GR63178A|GR-63178A|FD6QP9BP8U|GR-63178K|NSC 611615|Fosquidone; GR 63178K; GR 63178X|114517-04-3|Fosquidona|Fosquidonum|benzyl (14-methyl-8,13-dioxo-5,8,13,14-tetrahydrobenzo[5,6]isoindolo[2,1-b]isoquinolin-9-yl) hydrogen phosphate|Fosquidonum [INN-Latin]|UNII-FD6QP9BP8U|Fosquidona [INN-Spanish]|Fosquidone [USAN:INN:BAN]|FOSQUIDONE [INN]|Fosquidone (USAN/INN)|FOSQUIDONE [USAN]|SCHEMBL3897|benzyl 14-methyl-8,13-dioxo-5,8,13,14-tetrahydrobenz Show More⌵
Canonical SMILES: CC1c2ccccc2Cn2cc3c(c21)C(=O)c1cccc(OP(=O)(O)OCc2ccccc2)c1C3=O
Standard InChI: InChI=1S/C28H22NO6P/c1-17-20-11-6-5-10-19(20)14-29-15-22-25(26(17)29)27(30)21-12-7-13-23(24(21)28(22)31)35-36(32,33)34-16-18-8-3-2-4-9-18/h2-13,15,17H,14,16H2,1H3,(H,32,33)
Standard InChI Key: UXTSQCOOUJTIAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
5.6958 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9542 -4.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8708 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6167 -4.0083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7583 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2500 -2.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3125 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2833 -4.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0583 -2.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3208 -2.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1792 -4.6958 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5125 -2.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8125 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3750 -4.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2583 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9958 -1.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0167 -4.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3542 -3.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0083 -5.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9875 -4.8667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6083 -2.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6208 -6.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5750 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6708 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4500 -6.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9625 -2.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4500 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4167 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6667 -7.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0625 -7.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1542 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9000 -3.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4958 -7.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8917 -8.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1083 -8.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 3 1 0
5 2 1 0
6 1 1 0
7 9 2 0
8 2 2 0
9 6 1 0
10 3 1 0
11 15 1 0
12 7 1 0
13 10 1 0
14 4 1 0
15 12 1 0
16 13 2 0
17 6 2 0
18 5 2 0
19 11 2 0
20 11 1 0
21 11 1 0
22 9 1 0
23 20 1 0
24 10 1 0
25 29 1 0
26 23 1 0
27 13 1 0
28 16 1 0
29 22 2 0
30 26 1 0
31 26 2 0
32 27 2 0
33 32 1 0
34 30 2 0
35 31 1 0
36 34 1 0
8 4 1 0
5 7 1 0
16 14 1 0
25 12 2 0
33 28 2 0
36 35 2 0
M END
Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.46Molecular Weight (Monoisotopic): 499.1185AlogP: 5.47#Rotatable Bonds: 5Polar Surface Area: 94.83Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.32CX Basic pKa: ┄CX LogP: 5.34CX LogD: 2.96Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: 0.31
References 1. Roldós V, Carbajo RJ, Schott AK, Pineda-Lucena A, Ochoa-Callejero L, Martínez A, Ramos A, de Pascual-Teresa B.. (2012) Identification of first proadrenomedullin N-terminal 20 peptide (PAMP) modulator by means of virtual screening and NMR interaction experiments., 55 [PMID:22884224 ] [10.1016/j.ejmech.2012.07.031 ] 2. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date,