3-(1-(3-chlorobenzyl)piperidin-4-yl)-4-phenyl-3,4-dihydroquinazolin-2(1H)-one

ID: ALA201035

PubChem CID: 19423525

Max Phase: Preclinical

Molecular Formula: C26H26ClN3O

Molecular Weight: 431.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccccc2C(c2ccccc2)N1C1CCN(Cc2cccc(Cl)c2)CC1

Standard InChI:  InChI=1S/C26H26ClN3O/c27-21-10-6-7-19(17-21)18-29-15-13-22(14-16-29)30-25(20-8-2-1-3-9-20)23-11-4-5-12-24(23)28-26(30)31/h1-12,17,22,25H,13-16,18H2,(H,28,31)

Standard InChI Key:  FOPUJSJQHJHZKH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -4.0889   -6.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0901   -7.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3753   -7.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3771   -5.9664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6617   -6.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6583   -7.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9391   -7.6199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2187   -7.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2221   -6.3696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9459   -5.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9505   -5.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2394   -4.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2436   -3.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9608   -3.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6754   -3.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6677   -4.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5031   -7.6132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5089   -5.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2103   -6.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9213   -5.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9230   -5.1321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2074   -4.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5099   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6378   -4.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3520   -5.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3467   -5.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0600   -6.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7757   -5.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7737   -5.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0597   -4.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4870   -4.7123    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  5  4  1  0
 15 16  2  0
 16 11  1  0
  4  1  2  0
  8 17  2  0
  5 10  1  0
  9 18  1  0
 18 19  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5  6  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 10 11  1  0
 21 24  1  0
 24 25  1  0
 11 12  2  0
 25 26  2  0
  2  3  2  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  3  6  1  0
 28 29  1  0
 13 14  2  0
 29 30  2  0
 30 25  1  0
  1  2  1  0
 29 31  1  0
M  END

Associated Targets(non-human)

SLC8A1 Sodium/calcium exchanger 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.97Molecular Weight (Monoisotopic): 431.1764AlogP: 5.94#Rotatable Bonds: 4
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.78CX Basic pKa: 7.58CX LogP: 5.22CX LogD: 4.82
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.10

References

1. Hasegawa H, Muraoka M, Matsui K, Kojima A..  (2006)  A novel class of sodium/calcium exchanger inhibitors: design, synthesis, and structure-activity relationships of 4-phenyl-3-(piperidin-4-yl)-3,4-dihydro-2(1H)-quinazolinone derivatives.,  16  (3): [PMID:16249082] [10.1016/j.bmcl.2005.10.012]

Source