[13C]-2-(3-(7-(3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamido)heptyl)ureido)acetic acid

ID: ALA2011591

PubChem CID: 44623400

Max Phase: Preclinical

Molecular Formula: C26H38N6O4

Molecular Weight: 498.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCNC(=O)NC[13C](=O)O

Standard InChI:  InChI=1S/C26H38N6O4/c1-19-23(20-10-6-7-11-21(20)30-24(19)32-16-14-31(2)15-17-32)25(35)27-12-8-4-3-5-9-13-28-26(36)29-18-22(33)34/h6-7,10-11H,3-5,8-9,12-18H2,1-2H3,(H,27,35)(H,33,34)(H2,28,29,36)/i22+1

Standard InChI Key:  WAXMULZSNYUPJB-ZVDSADNZSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   -1.3514  -10.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3526  -11.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6378  -11.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6396   -9.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0758  -10.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0766  -11.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7919  -11.5383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5069  -11.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5021  -10.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7862   -9.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2230  -11.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2219  -12.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9338  -12.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6491  -12.3526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6479  -11.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9314  -11.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3636  -12.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2141   -9.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7819   -9.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4941   -8.6451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0652   -8.6526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4898   -7.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2020   -7.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9187   -7.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6310   -7.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3476   -7.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0599   -7.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7765   -7.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4888   -7.3811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2055   -7.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9177   -7.3735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2098   -8.6148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6344   -7.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3467   -7.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0660   -7.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3449   -6.5377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 14 17  1  0
  5  4  2  0
  9 18  1  0
  8  9  1  0
 10 19  1  0
  4  1  1  0
 19 20  1  0
  9 10  2  0
 19 21  2  0
 10  5  1  0
 20 22  1  0
 22 23  1  0
  8 11  1  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  2  3  1  0
 25 26  1  0
  5  6  1  0
 26 27  1  0
  3  6  2  0
 27 28  1  0
  6  7  1  0
 28 29  1  0
  1  2  2  0
 29 30  1  0
 11 16  1  0
 30 31  1  0
 12 13  1  0
 30 32  2  0
 13 14  1  0
 31 33  1  0
 14 15  1  0
 33 34  1  0
 15 16  1  0
  7  8  2  0
 34 35  1  0
 34 36  2  0
M  ISO  1  34  13
M  END

Associated Targets(non-human)

Htr3a Serotonin 3a (5-HT3a) receptor (173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.63Molecular Weight (Monoisotopic): 498.2955AlogP: 2.36#Rotatable Bonds: 12
Polar Surface Area: 126.90Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.97CX Basic pKa: 7.50CX LogP: -0.14CX LogD: -0.33
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -0.99

References

1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S..  (2011)  Bivalent Ligands for the Serotonin 5-HT3 Receptor.,  (8): [PMID:24900351] [10.1021/ml2000388]

Source