[13C]-(3-{2-[2-(2-{[3-Methyl-2-(4-methyl-piperazin-1-yl)-quinoline-4-carbony l]-amino}-ethoxy)-ethoxy]-ethyl}-ureido)-acetic acid

ID: ALA2011592

PubChem CID: 75083735

Max Phase: Preclinical

Molecular Formula: C25H36N6O6

Molecular Weight: 516.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCOCCOCCNC(=O)NC[13C](=O)O

Standard InChI:  InChI=1S/C25H36N6O6/c1-18-22(19-5-3-4-6-20(19)29-23(18)31-11-9-30(2)10-12-31)24(34)26-7-13-36-15-16-37-14-8-27-25(35)28-17-21(32)33/h3-6H,7-17H2,1-2H3,(H,26,34)(H,32,33)(H2,27,28,35)/i21+1

Standard InChI Key:  WZFUDBWXCSNZLO-ODHDQMIASA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   16.2526   -8.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9641   -7.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9583   -7.0616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6815   -8.2940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6630   -6.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3615   -7.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3348   -7.9072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0950   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6944  -10.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6932  -11.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4081  -12.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4063  -10.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1216  -10.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1224  -11.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8377  -12.0550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5527  -11.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5480  -10.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8321  -10.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2688  -12.0499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2677  -12.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9796  -13.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6950  -12.8693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6937  -12.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9772  -11.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4095  -13.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2599  -10.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8277   -9.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5400   -9.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1111   -9.1693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5356   -8.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2479   -7.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9645   -8.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6768   -7.9129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3934   -8.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1057   -7.9053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8224   -8.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5346   -7.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  2  0
 16 19  1  0
 19 20  1  0
  2  3  1  0
 10 11  1  0
 11 14  2  0
  5  6  1  0
 13 12  2  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 12  9  1  0
 22 25  1  0
  1  2  1  0
 17 26  1  0
  2  4  2  0
 18 27  1  0
 13 14  1  0
 27 28  1  0
  6  7  1  0
 27 29  2  0
 14 15  1  0
 28 30  1  0
  6  8  2  0
 30 31  1  0
 15 16  2  0
 31 32  1  0
 32 33  1  0
 16 17  1  0
 33 34  1  0
  3  5  1  0
 34 35  1  0
 17 18  2  0
 35 36  1  0
 18 13  1  0
 36 37  1  0
 37  1  1  0
M  ISO  1   6  13
M  END

Associated Targets(non-human)

Htr3a Serotonin 3a (5-HT3a) receptor (173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.60Molecular Weight (Monoisotopic): 516.2696AlogP: 0.44#Rotatable Bonds: 13
Polar Surface Area: 145.36Molecular Species: ACIDHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.69CX Basic pKa: 7.50CX LogP: -2.16CX LogD: -2.35
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.17

References

1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S..  (2011)  Bivalent Ligands for the Serotonin 5-HT3 Receptor.,  (8): [PMID:24900351] [10.1021/ml2000388]

Source