The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[13C]-(3-{2-[2-(2-{[3-Methyl-2-(4-methyl-piperazin-1-yl)-quinoline-4-carbony l]-amino}-ethoxy)-ethoxy]-ethyl}-ureido)-acetic acid ID: ALA2011592
PubChem CID: 75083735
Max Phase: Preclinical
Molecular Formula: C25H36N6O6
Molecular Weight: 516.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCOCCOCCNC(=O)NC[13C](=O)O
Standard InChI: InChI=1S/C25H36N6O6/c1-18-22(19-5-3-4-6-20(19)29-23(18)31-11-9-30(2)10-12-31)24(34)26-7-13-36-15-16-37-14-8-27-25(35)28-17-21(32)33/h3-6H,7-17H2,1-2H3,(H,26,34)(H,32,33)(H2,27,28,35)/i21+1
Standard InChI Key: WZFUDBWXCSNZLO-ODHDQMIASA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
16.2526 -8.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9641 -7.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9583 -7.0616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6815 -8.2940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6630 -6.6430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3615 -7.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3348 -7.9072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0950 -6.6972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6944 -10.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6932 -11.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4081 -12.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4063 -10.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1216 -10.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1224 -11.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8377 -12.0550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5527 -11.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5480 -10.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8321 -10.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2688 -12.0499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2677 -12.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9796 -13.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6950 -12.8693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6937 -12.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9772 -11.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4095 -13.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2599 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8277 -9.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5400 -9.1617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1111 -9.1693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5356 -8.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2479 -7.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9645 -8.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6768 -7.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3934 -8.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1057 -7.9053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8224 -8.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5346 -7.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 2 0
16 19 1 0
19 20 1 0
2 3 1 0
10 11 1 0
11 14 2 0
5 6 1 0
13 12 2 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
12 9 1 0
22 25 1 0
1 2 1 0
17 26 1 0
2 4 2 0
18 27 1 0
13 14 1 0
27 28 1 0
6 7 1 0
27 29 2 0
14 15 1 0
28 30 1 0
6 8 2 0
30 31 1 0
15 16 2 0
31 32 1 0
32 33 1 0
16 17 1 0
33 34 1 0
3 5 1 0
34 35 1 0
17 18 2 0
35 36 1 0
18 13 1 0
36 37 1 0
37 1 1 0
M ISO 1 6 13
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.60Molecular Weight (Monoisotopic): 516.2696AlogP: 0.44#Rotatable Bonds: 13Polar Surface Area: 145.36Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.69CX Basic pKa: 7.50CX LogP: -2.16CX LogD: -2.35Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.17
References 1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S.. (2011) Bivalent Ligands for the Serotonin 5-HT3 Receptor., 2 (8): [PMID:24900351 ] [10.1021/ml2000388 ]