tert-butyl 7-(3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamido)heptylcarbamate

ID: ALA2011596

PubChem CID: 70681001

Max Phase: Preclinical

Molecular Formula: C28H43N5O3

Molecular Weight: 497.68

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCNC(=O)OC(C)(C)C

Standard InChI:  InChI=1S/C28H43N5O3/c1-21-24(22-13-9-10-14-23(22)31-25(21)33-19-17-32(5)18-20-33)26(34)29-15-11-7-6-8-12-16-30-27(35)36-28(2,3)4/h9-10,13-14H,6-8,11-12,15-20H2,1-5H3,(H,29,34)(H,30,35)

Standard InChI Key:  PWYWGJDVCMKQQI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    9.0354    2.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7477    2.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4643    2.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1766    2.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8932    2.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6055    2.4481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3221    2.8568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0344    2.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7511    2.8492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0300    1.6155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7554    3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4721    4.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0432    4.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7498    4.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4819   -0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4807   -0.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1956   -1.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1938    0.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9091   -0.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9099   -0.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6252   -1.2550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3402   -0.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3355   -0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6196    0.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0563   -1.2499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0552   -2.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7671   -2.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4825   -2.0693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4812   -1.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7647   -0.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1970   -2.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0474    0.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6152    1.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3275    1.6383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8986    1.6307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3231    2.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 15  1  0
  4  5  1  0
  8 10  2  0
 19 20  1  0
  2  3  1  0
 20 21  1  0
  9 11  1  0
 21 22  2  0
  5  6  1  0
 22 23  1  0
 11 12  1  0
 23 24  2  0
 24 19  1  0
  1  2  1  0
 22 25  1  0
 25 26  1  0
 11 13  1  0
  6  7  1  0
 11 14  1  0
  3  4  1  0
  7  8  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 15 16  2  0
 28 31  1  0
 23 32  1  0
 16 17  1  0
 24 33  1  0
 17 20  2  0
 33 34  1  0
  8  9  1  0
 33 35  2  0
 19 18  2  0
 34 36  1  0
 36  1  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2011596

   tert-butyl N-[7-[[3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carbonyl]amino]heptyl]carbamate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 497.68

Molecular Weight (Monoisotopic): 497.3366

AlogP: 4.50

#Rotatable Bonds: 10

Polar Surface Area: 86.80

Molecular Species: NEUTRAL

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: 7.50

CX LogP: 4.87

CX LogD: 4.52

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.47

Np Likeness Score: -0.97

References

1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S..  (2011)  Bivalent Ligands for the Serotonin 5-HT3 Receptor.,  2  (8): [PMID:24900351] [10.1021/ml2000388]

Source

Source(1):

• Scientific Literature