tert-Butyl 8-(3-Methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamido)octylcarbamate

ID: ALA2011597

PubChem CID: 70685203

Max Phase: Preclinical

Molecular Formula: C29H45N5O3

Molecular Weight: 511.71

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCCNC(=O)OC(C)(C)C

Standard InChI:  InChI=1S/C29H45N5O3/c1-22-25(23-14-10-11-15-24(23)32-26(22)34-20-18-33(5)19-21-34)27(35)30-16-12-8-6-7-9-13-17-31-28(36)37-29(2,3)4/h10-11,14-15H,6-9,12-13,16-21H2,1-5H3,(H,30,35)(H,31,36)

Standard InChI Key:  MDTICLULVWNTBA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   20.4520    3.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1643    3.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8810    3.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5932    3.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3099    3.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0222    3.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7388    3.3307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4511    3.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1677    3.3383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4467    4.5780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1721    2.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8888    2.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4598    2.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1664    1.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1819    0.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1807   -0.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8956   -0.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8938    1.2253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6091    0.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6099   -0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3252   -0.4216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0402   -0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0355    0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3196    1.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7563   -0.4166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7552   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4671   -1.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1825   -1.2360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1812   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4647    0.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8970   -1.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7474    1.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3152    2.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0275    2.4716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5986    2.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0231    3.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7354    3.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  8 10  2  0
 19 20  1  0
  2  3  1  0
 20 21  1  0
  9 11  1  0
 21 22  2  0
  5  6  1  0
 22 23  1  0
 11 12  1  0
 23 24  2  0
 24 19  1  0
  1  2  1  0
 22 25  1  0
 25 26  1  0
 11 13  1  0
  6  7  1  0
 11 14  1  0
  3  4  1  0
  7  8  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 15 16  2  0
 28 31  1  0
 23 32  1  0
 16 17  1  0
 24 33  1  0
 17 20  2  0
 33 34  1  0
  8  9  1  0
 33 35  2  0
 19 18  2  0
 34 36  1  0
 18 15  1  0
 36 37  1  0
 37  1  1  0
M  END

Associated Targets(non-human)

Htr3a Serotonin 3a (5-HT3a) receptor (173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.71Molecular Weight (Monoisotopic): 511.3522AlogP: 4.89#Rotatable Bonds: 11
Polar Surface Area: 86.80Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.50CX LogP: 5.32CX LogD: 4.97
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.95

References

1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S..  (2011)  Bivalent Ligands for the Serotonin 5-HT3 Receptor.,  (8): [PMID:24900351] [10.1021/ml2000388]

Source