The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl 8-(3-Methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamido)octylcarbamate ID: ALA2011597
PubChem CID: 70685203
Max Phase: Preclinical
Molecular Formula: C29H45N5O3
Molecular Weight: 511.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCCNC(=O)OC(C)(C)C
Standard InChI: InChI=1S/C29H45N5O3/c1-22-25(23-14-10-11-15-24(23)32-26(22)34-20-18-33(5)19-21-34)27(35)30-16-12-8-6-7-9-13-17-31-28(36)37-29(2,3)4/h10-11,14-15H,6-9,12-13,16-21H2,1-5H3,(H,30,35)(H,31,36)
Standard InChI Key: MDTICLULVWNTBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
20.4520 3.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1643 3.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8810 3.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5932 3.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3099 3.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0222 3.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7388 3.3307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4511 3.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1677 3.3383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4467 4.5780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1721 2.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8888 2.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4598 2.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1664 1.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1819 0.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1807 -0.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8956 -0.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8938 1.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6091 0.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6099 -0.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3252 -0.4216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0402 -0.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0355 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3196 1.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7563 -0.4166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7552 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4671 -1.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1825 -1.2360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1812 -0.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4647 0.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8970 -1.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7474 1.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3152 2.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0275 2.4716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5986 2.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0231 3.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7354 3.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
8 10 2 0
19 20 1 0
2 3 1 0
20 21 1 0
9 11 1 0
21 22 2 0
5 6 1 0
22 23 1 0
11 12 1 0
23 24 2 0
24 19 1 0
1 2 1 0
22 25 1 0
25 26 1 0
11 13 1 0
6 7 1 0
11 14 1 0
3 4 1 0
7 8 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
15 16 2 0
28 31 1 0
23 32 1 0
16 17 1 0
24 33 1 0
17 20 2 0
33 34 1 0
8 9 1 0
33 35 2 0
19 18 2 0
34 36 1 0
18 15 1 0
36 37 1 0
37 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.71Molecular Weight (Monoisotopic): 511.3522AlogP: 4.89#Rotatable Bonds: 11Polar Surface Area: 86.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.50CX LogP: 5.32CX LogD: 4.97Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.95
References 1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S.. (2011) Bivalent Ligands for the Serotonin 5-HT3 Receptor., 2 (8): [PMID:24900351 ] [10.1021/ml2000388 ]