The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 2-(2-(2-(3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamido)ethoxy)ethoxy)ethylcarbamate ID: ALA2011598
PubChem CID: 70695733
Max Phase: Preclinical
Molecular Formula: C27H41N5O5
Molecular Weight: 515.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCOCCOCCNC(=O)OC(C)(C)C
Standard InChI: InChI=1S/C27H41N5O5/c1-20-23(21-8-6-7-9-22(21)30-24(20)32-14-12-31(5)13-15-32)25(33)28-10-16-35-18-19-36-17-11-29-26(34)37-27(2,3)4/h6-9H,10-19H2,1-5H3,(H,28,33)(H,29,34)
Standard InChI Key: NCRXNBZLAOHEGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
-1.5230 -4.6629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8107 -4.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0940 -4.6553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6182 -4.2390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3349 -4.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0472 -4.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7638 -4.6401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4761 -4.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1927 -4.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4717 -3.3989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1971 -5.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9138 -5.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4848 -5.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1914 -6.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7931 -7.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7943 -7.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0794 -8.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0812 -6.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3659 -7.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3651 -7.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6498 -8.3925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9348 -7.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9395 -7.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6554 -6.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2187 -8.3874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2198 -9.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5079 -9.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7925 -9.2068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7938 -8.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5103 -7.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0780 -9.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2276 -6.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6598 -5.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9475 -5.4992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3764 -5.5068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9519 -4.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2396 -4.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
8 10 2 0
19 20 1 0
2 3 1 0
20 21 1 0
9 11 1 0
21 22 2 0
5 6 1 0
22 23 1 0
11 12 1 0
23 24 2 0
24 19 1 0
1 2 1 0
22 25 1 0
25 26 1 0
11 13 1 0
6 7 1 0
11 14 1 0
3 4 1 0
7 8 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
15 16 2 0
28 31 1 0
23 32 1 0
16 17 1 0
24 33 1 0
17 20 2 0
33 34 1 0
8 9 1 0
33 35 2 0
19 18 2 0
34 36 1 0
18 15 1 0
36 37 1 0
37 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.66Molecular Weight (Monoisotopic): 515.3108AlogP: 2.58#Rotatable Bonds: 11Polar Surface Area: 105.26Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.50CX LogP: 2.87CX LogD: 2.52Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -1.16
References 1. Cappelli A, Manini M, Paolino M, Gallelli A, Anzini M, Mennuni L, Del Cadia M, De Rienzo F, Menziani MC, Vomero S.. (2011) Bivalent Ligands for the Serotonin 5-HT3 Receptor., 2 (8): [PMID:24900351 ] [10.1021/ml2000388 ]