3-(1-(furan-3-ylmethyl)piperidin-4-yl)-4-phenyl-3,4-dihydroquinazolin-2(1H)-one

ID: ALA201213

PubChem CID: 19423612

Max Phase: Preclinical

Molecular Formula: C24H25N3O2

Molecular Weight: 387.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccccc2C(c2ccccc2)N1C1CCN(Cc2ccoc2)CC1

Standard InChI:  InChI=1S/C24H25N3O2/c28-24-25-22-9-5-4-8-21(22)23(19-6-2-1-3-7-19)27(24)20-10-13-26(14-11-20)16-18-12-15-29-17-18/h1-9,12,15,17,20,23H,10-11,13-14,16H2,(H,25,28)

Standard InChI Key:  IVKNLZSKZHRHJH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    8.3493  -29.7496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0620  -29.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0620  -28.5151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3493  -28.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6366  -29.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6391  -28.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9280  -28.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2137  -28.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2152  -29.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9269  -29.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7766  -29.7548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3478  -27.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0657  -26.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0647  -26.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3482  -25.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6314  -26.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6360  -26.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7784  -28.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4913  -28.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2055  -28.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2122  -27.2850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4984  -26.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7779  -27.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9301  -26.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9356  -26.0512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6034  -25.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3535  -24.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5277  -24.7789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2673  -25.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
  6  7  2  0
 14 15  2  0
  1  2  1  0
 15 16  1  0
  7  8  1  0
 16 17  2  0
 17 12  1  0
  2  3  1  0
  3 18  1  0
 18 19  1  0
  8  9  2  0
  3  4  1  0
  9 10  1  0
 10  5  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  2 11  2  0
 21 24  1  0
  6  4  1  0
 24 25  1  0
 25 26  1  0
  4 12  1  0
  5  6  1  0
 12 13  2  0
  5  1  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 25  2  0
M  END

Associated Targets(non-human)

SLC8A1 Sodium/calcium exchanger 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.48Molecular Weight (Monoisotopic): 387.1947AlogP: 4.88#Rotatable Bonds: 4
Polar Surface Area: 48.72Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.78CX Basic pKa: 7.55CX LogP: 3.75CX LogD: 3.37
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -0.53

References

1. Hasegawa H, Muraoka M, Matsui K, Kojima A..  (2006)  A novel class of sodium/calcium exchanger inhibitors: design, synthesis, and structure-activity relationships of 4-phenyl-3-(piperidin-4-yl)-3,4-dihydro-2(1H)-quinazolinone derivatives.,  16  (3): [PMID:16249082] [10.1016/j.bmcl.2005.10.012]

Source