2-Acetyl-8-(N,N-diacetylamino)-6-benzyl-7-oxo-3-phenyl-2,3-dihydro-7H-[1,2,4]triazolo[4,3-b][1,2,4]triazine

ID: ALA2013091

PubChem CID: 70695838

Max Phase: Preclinical

Molecular Formula: C23H22N6O4

Molecular Weight: 446.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1N=C2N(N=C(Cc3ccccc3)C(=O)N2N(C(C)=O)C(C)=O)C1c1ccccc1

Standard InChI:  InChI=1S/C23H22N6O4/c1-15(30)26-21(19-12-8-5-9-13-19)27-23(25-26)29(28(16(2)31)17(3)32)22(33)20(24-27)14-18-10-6-4-7-11-18/h4-13,21H,14H2,1-3H3

Standard InChI Key:  RPSOUVHBNHLMGM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   16.7711   -0.1941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4870   -0.6066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4870   -1.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7711   -1.8441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0594   -1.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0594   -0.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7564   -1.0191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2716   -1.6887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2707   -0.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7105    0.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3225    1.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7592    1.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5820    1.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9700    1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5343    0.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3436   -1.8441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3436   -0.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6277   -0.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6277   -1.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9160   -1.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2001   -1.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2001   -0.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9160   -0.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7711   -2.6691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0594   -3.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0594   -3.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3436   -2.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4870   -3.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4870   -3.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2029   -2.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5814   -1.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9939   -0.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9939   -1.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  2  9  1  0
  3  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  9 10  1  0
  5 16  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
  6 17  1  0
 25 26  2  0
 25 27  1  0
 24 25  1  0
 28 29  2  0
 28 30  1  0
 24 28  1  0
  4 24  1  0
 31 32  2  0
 31 33  1  0
  7 31  1  0
M  END

Associated Targets(non-human)

Cyp1a1 Cytochrome P450 1A1 (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.47Molecular Weight (Monoisotopic): 446.1703AlogP: 1.87#Rotatable Bonds: 4
Polar Surface Area: 105.96Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.35CX LogD: 2.35
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.71Np Likeness Score: -0.49

References

1. El Massry AM, Asal AM, Khattab SN, Haiba NS, Awney HA, Helmy M, Langer V, Amer A..  (2012)  Synthesis and structure elucidation of novel fused 1,2,4-triazine derivatives as potent inhibitors targeting CYP1A1 activity.,  20  (8): [PMID:22414679] [10.1016/j.bmc.2012.02.041]

Source