2-Acetyl-8-(N,N-diacetylamino)-6-(4-methoxybenzyl)-7-oxo-3-phenyl-2,3-dihydro-7H-[1,2,4]triazolo[4,3-b][1,2,4]triazine

ID: ALA2013092

PubChem CID: 70687458

Max Phase: Preclinical

Molecular Formula: C24H24N6O5

Molecular Weight: 476.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CC2=NN3C(=NN(C(C)=O)C3c3ccccc3)N(N(C(C)=O)C(C)=O)C2=O)cc1

Standard InChI:  InChI=1S/C24H24N6O5/c1-15(31)27-22(19-8-6-5-7-9-19)28-24(26-27)30(29(16(2)32)17(3)33)23(34)21(25-28)14-18-10-12-20(35-4)13-11-18/h5-13,22H,14H2,1-4H3

Standard InChI Key:  CPWTZWBJBQTKKP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    1.0545   -8.2022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7702   -8.6147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7702   -9.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0545   -9.8522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3428   -9.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3428   -8.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0396   -9.0272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5550   -9.6968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5541   -8.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9938   -7.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6058   -6.9350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0425   -6.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8652   -6.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2532   -6.9916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8175   -7.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3731   -9.8522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3731   -8.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0890   -8.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0890   -9.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8006   -9.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5165   -9.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5165   -8.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8006   -8.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0545  -10.6772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3428  -11.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3428  -11.9146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3731  -10.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7702  -11.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7702  -11.9146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4862  -10.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8646   -9.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2771   -8.3155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2771   -9.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2307   -9.8525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9454   -9.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  2  9  1  0
  3  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  9 10  1  0
  5 16  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
  6 17  1  0
 25 26  2  0
 25 27  1  0
 24 25  1  0
 28 29  2  0
 28 30  1  0
 24 28  1  0
  4 24  1  0
 31 32  2  0
 31 33  1  0
  7 31  1  0
 21 34  1  0
  1  2  1  0
 34 35  1  0
M  END

Associated Targets(non-human)

Cyp1a1 Cytochrome P450 1A1 (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.49Molecular Weight (Monoisotopic): 476.1808AlogP: 1.88#Rotatable Bonds: 5
Polar Surface Area: 115.19Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.19CX LogD: 2.19
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.65Np Likeness Score: -0.50

References

1. El Massry AM, Asal AM, Khattab SN, Haiba NS, Awney HA, Helmy M, Langer V, Amer A..  (2012)  Synthesis and structure elucidation of novel fused 1,2,4-triazine derivatives as potent inhibitors targeting CYP1A1 activity.,  20  (8): [PMID:22414679] [10.1016/j.bmc.2012.02.041]

Source