2-Acetyl-8-(N,N-diacetylamino)-6-(4-methoxybenzyl)-3-methyl-7-oxo-3-p-tolyl-2,3-dihydro-7H-[1,2,4]triazolo[4,3-b][1,2,4]triazine

ID: ALA2013094

PubChem CID: 70683230

Max Phase: Preclinical

Molecular Formula: C26H28N6O5

Molecular Weight: 504.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CC2=NN3C(=NN(C(C)=O)C3(C)c3ccc(C)cc3)N(N(C(C)=O)C(C)=O)C2=O)cc1

Standard InChI:  InChI=1S/C26H28N6O5/c1-16-7-11-21(12-8-16)26(5)31(19(4)35)28-25-30(29(17(2)33)18(3)34)24(36)23(27-32(25)26)15-20-9-13-22(37-6)14-10-20/h7-14H,15H2,1-6H3

Standard InChI Key:  SUTGDEMSFBZPQW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    1.7210  -22.5300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4368  -22.9424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4368  -23.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7210  -24.1798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0093  -23.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0093  -22.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7061  -23.3549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2214  -24.0245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2198  -22.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6583  -21.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2691  -21.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7045  -20.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5273  -20.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9165  -21.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4821  -22.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2936  -24.1798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2936  -22.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4223  -22.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4223  -23.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1339  -24.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8498  -23.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8498  -22.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1339  -22.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7210  -25.0048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0093  -25.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0093  -26.2422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2936  -25.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4368  -25.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4368  -26.2422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1527  -25.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5311  -23.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9435  -22.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9435  -24.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5640  -24.1801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2786  -23.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7440  -22.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9644  -19.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  2  9  1  0
  3  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  9 10  1  0
  5 16  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
  6 17  1  0
 25 26  2  0
 25 27  1  0
 24 25  1  0
 28 29  2  0
 28 30  1  0
 24 28  1  0
  4 24  1  0
 31 32  2  0
 31 33  1  0
  7 31  1  0
 21 34  1  0
  1  2  1  0
 34 35  1  0
  2  3  1  0
  9 36  1  0
  3  4  1  0
 13 37  1  0
M  END

Associated Targets(non-human)

Cyp1a1 Cytochrome P450 1A1 (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.55Molecular Weight (Monoisotopic): 504.2121AlogP: 2.36#Rotatable Bonds: 5
Polar Surface Area: 115.19Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.62Np Likeness Score: -0.36

References

1. El Massry AM, Asal AM, Khattab SN, Haiba NS, Awney HA, Helmy M, Langer V, Amer A..  (2012)  Synthesis and structure elucidation of novel fused 1,2,4-triazine derivatives as potent inhibitors targeting CYP1A1 activity.,  20  (8): [PMID:22414679] [10.1016/j.bmc.2012.02.041]

Source