2-Acetyl-8-(N-acetylamino)-6-benzyl-3-methyl-7-oxo-3-phenyl-2,3-dihydro-7H-[1,2,4]triazolo[4,3-b][1,2,4]triazine

ID: ALA2013095

PubChem CID: 70689513

Max Phase: Preclinical

Molecular Formula: C22H22N6O3

Molecular Weight: 418.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)NN1C(=O)C(Cc2ccccc2)=NN2C1=NN(C(C)=O)C2(C)c1ccccc1

Standard InChI:  InChI=1S/C22H22N6O3/c1-15(29)23-26-20(31)19(14-17-10-6-4-7-11-17)24-28-21(26)25-27(16(2)30)22(28,3)18-12-8-5-9-13-18/h4-13H,14H2,1-3H3,(H,23,29)

Standard InChI Key:  AFHWKFGTVYSTOM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    0.1752   -1.1365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8901   -1.5571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8824   -2.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1711   -2.7861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5436   -2.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5401   -1.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1585   -1.9718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6685   -2.6392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6800   -1.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1189   -0.6058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7329    0.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1761    0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9984    0.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3834    0.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9440   -0.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2590   -2.7825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2743   -0.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2549   -1.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9661   -1.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9739   -2.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6929   -2.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4000   -2.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3979   -1.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6831   -1.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1655   -3.6131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5499   -4.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2667   -3.6058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5555   -4.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9970   -1.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4075   -2.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4210   -1.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  2  9  1  0
  3  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  9 10  1  0
  5 16  2  0
  9 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
  6 18  1  0
 26 27  2  0
 26 28  1  0
 25 26  1  0
  4 25  1  0
  7 29  1  0
  1  2  1  0
 29 30  1  0
  2  3  1  0
 29 31  2  0
M  END

Associated Targets(non-human)

Cyp1a1 Cytochrome P450 1A1 (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.46Molecular Weight (Monoisotopic): 418.1753AlogP: 1.79#Rotatable Bonds: 4
Polar Surface Area: 97.68Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.98CX Basic pKa: CX LogP: 2.61CX LogD: 2.61
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.82Np Likeness Score: -0.43

References

1. El Massry AM, Asal AM, Khattab SN, Haiba NS, Awney HA, Helmy M, Langer V, Amer A..  (2012)  Synthesis and structure elucidation of novel fused 1,2,4-triazine derivatives as potent inhibitors targeting CYP1A1 activity.,  20  (8): [PMID:22414679] [10.1016/j.bmc.2012.02.041]

Source