2-Acetyl-8-(N-acetylamino)-6-(4-methoxybenzyl)-3-methyl-7-oxo-3-phenyl-2,3-dihydro-7H-[1,2,4]triazolo[4,3-b][1,2,4]triazine

ID: ALA2013096

PubChem CID: 70687459

Max Phase: Preclinical

Molecular Formula: C23H24N6O4

Molecular Weight: 448.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CC2=NN3C(=NN(C(C)=O)C3(C)c3ccccc3)N(NC(C)=O)C2=O)cc1

Standard InChI:  InChI=1S/C23H24N6O4/c1-15(30)24-27-21(32)20(14-17-10-12-19(33-4)13-11-17)25-29-22(27)26-28(16(2)31)23(29,3)18-8-6-5-7-9-18/h5-13H,14H2,1-4H3,(H,24,30)

Standard InChI Key:  ZBMBCRFIBFCNTG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   11.8190   -0.7936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5374   -1.2141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5297   -2.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8149   -2.4420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1048   -2.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1084   -1.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8005   -1.6284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3152   -2.2952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3266   -0.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7610   -0.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3795    0.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8224    1.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6440    1.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0286    0.3990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5855   -0.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3901   -2.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9172   -0.2406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3941   -0.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6794   -1.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6716   -2.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9574   -2.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2467   -2.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2488   -1.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9672   -0.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8093   -3.2683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0987   -3.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3823   -3.2610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0930   -4.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6426   -1.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0527   -2.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0662   -0.9169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5222   -2.4331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7962   -2.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  2  9  1  0
  3  8  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
  9 10  1  0
  5 16  2  0
  9 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
  6 18  1  0
 26 27  2  0
 26 28  1  0
 25 26  1  0
  4 25  1  0
  7 29  1  0
  1  2  1  0
 29 30  1  0
  2  3  1  0
 29 31  2  0
  3  4  1  0
 22 32  1  0
  4  5  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Cyp1a1 Cytochrome P450 1A1 (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1859AlogP: 1.79#Rotatable Bonds: 5
Polar Surface Area: 106.91Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.75CX Basic pKa: CX LogP: 2.45CX LogD: 2.45
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.75Np Likeness Score: -0.44

References

1. El Massry AM, Asal AM, Khattab SN, Haiba NS, Awney HA, Helmy M, Langer V, Amer A..  (2012)  Synthesis and structure elucidation of novel fused 1,2,4-triazine derivatives as potent inhibitors targeting CYP1A1 activity.,  20  (8): [PMID:22414679] [10.1016/j.bmc.2012.02.041]

Source