3-(1-(3-methoxybenzyl)piperidin-4-yl)-4-phenyl-3,4-dihydroquinazolin-2(1H)-one

ID: ALA201338

PubChem CID: 11553689

Max Phase: Preclinical

Molecular Formula: C27H29N3O2

Molecular Weight: 427.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(CN2CCC(N3C(=O)Nc4ccccc4C3c3ccccc3)CC2)c1

Standard InChI:  InChI=1S/C27H29N3O2/c1-32-23-11-7-8-20(18-23)19-29-16-14-22(15-17-29)30-26(21-9-3-2-4-10-21)24-12-5-6-13-25(24)28-27(30)31/h2-13,18,22,26H,14-17,19H2,1H3,(H,28,31)

Standard InChI Key:  UYHOJKWVMNWOSQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    6.7819  -11.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7807  -12.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4956  -13.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4938  -11.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2091  -11.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2126  -12.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9317  -13.0907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6521  -12.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6487  -11.8404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9249  -11.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9204  -10.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6315  -10.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6273   -9.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9100   -8.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1955   -9.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2032  -10.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3677  -13.0841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3619  -11.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0811  -11.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7922  -11.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7939  -10.6030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0783  -10.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3610  -10.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5086  -10.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2228  -10.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2175  -11.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9308  -11.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6466  -11.4269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6445  -10.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9306  -10.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3578  -10.1831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0734  -10.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  4  1  0
 15 16  2  0
 16 11  1  0
  4  1  2  0
  8 17  2  0
  5 10  1  0
  9 18  1  0
 18 19  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5  6  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 10 11  1  0
 21 24  1  0
 24 25  1  0
 11 12  2  0
 25 26  2  0
  2  3  2  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  3  6  1  0
 28 29  1  0
 13 14  2  0
 29 30  2  0
 30 25  1  0
  1  2  1  0
 29 31  1  0
 14 15  1  0
 31 32  1  0
M  END

Associated Targets(non-human)

SLC8A1 Sodium/calcium exchanger 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.55Molecular Weight (Monoisotopic): 427.2260AlogP: 5.30#Rotatable Bonds: 5
Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.78CX Basic pKa: 8.02CX LogP: 4.45CX LogD: 3.74
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -0.85

References

1. Hasegawa H, Muraoka M, Matsui K, Kojima A..  (2006)  A novel class of sodium/calcium exchanger inhibitors: design, synthesis, and structure-activity relationships of 4-phenyl-3-(piperidin-4-yl)-3,4-dihydro-2(1H)-quinazolinone derivatives.,  16  (3): [PMID:16249082] [10.1016/j.bmcl.2005.10.012]

Source