3-(1-(4-chlorobenzyl)piperidin-4-yl)-4-phenyl-3,4-dihydroquinazolin-2(1H)-one

ID: ALA201390

PubChem CID: 19423554

Max Phase: Preclinical

Molecular Formula: C26H26ClN3O

Molecular Weight: 431.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccccc2C(c2ccccc2)N1C1CCN(Cc2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C26H26ClN3O/c27-21-12-10-19(11-13-21)18-29-16-14-22(15-17-29)30-25(20-6-2-1-3-7-20)23-8-4-5-9-24(23)28-26(30)31/h1-13,22,25H,14-18H2,(H,28,31)

Standard InChI Key:  NBWUEXRNUZNQAL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    7.6069   -6.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6057   -7.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3206   -7.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3188   -6.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0341   -6.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0376   -7.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7567   -7.8740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4771   -7.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4737   -6.6238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7499   -6.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7454   -5.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4565   -4.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4523   -4.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7350   -3.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0205   -4.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0282   -4.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1927   -7.8674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1869   -6.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9061   -6.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6172   -6.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6189   -5.3863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9033   -4.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1860   -5.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3336   -4.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0478   -5.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0425   -6.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7558   -6.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4716   -6.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4695   -5.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7556   -4.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1863   -6.6223    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  5  4  1  0
 15 16  2  0
 16 11  1  0
  4  1  2  0
  8 17  2  0
  5 10  1  0
  9 18  1  0
 18 19  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5  6  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 10 11  1  0
 21 24  1  0
 24 25  1  0
 11 12  2  0
 25 26  2  0
  2  3  2  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  3  6  1  0
 28 29  1  0
 13 14  2  0
 29 30  2  0
 30 25  1  0
  1  2  1  0
 28 31  1  0
M  END

Associated Targets(non-human)

SLC8A1 Sodium/calcium exchanger 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.97Molecular Weight (Monoisotopic): 431.1764AlogP: 5.94#Rotatable Bonds: 4
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.78CX Basic pKa: 7.54CX LogP: 5.22CX LogD: 4.84
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -0.93

References

1. Hasegawa H, Muraoka M, Matsui K, Kojima A..  (2006)  A novel class of sodium/calcium exchanger inhibitors: design, synthesis, and structure-activity relationships of 4-phenyl-3-(piperidin-4-yl)-3,4-dihydro-2(1H)-quinazolinone derivatives.,  16  (3): [PMID:16249082] [10.1016/j.bmcl.2005.10.012]

Source