The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-Di-(4'-methoxy-3'-allylphenyl)-phenol ID: ALA2018418
PubChem CID: 70681265
Max Phase: Preclinical
Molecular Formula: C29H30O3
Molecular Weight: 426.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1cc(-c2ccc(OC)c(CC=C)c2)c(O)c(-c2ccc(OC)c(CC=C)c2)c1
Standard InChI: InChI=1S/C29H30O3/c1-6-9-20-16-25(21-12-14-27(31-4)23(18-21)10-7-2)29(30)26(17-20)22-13-15-28(32-5)24(19-22)11-8-3/h6-8,12-19,30H,1-3,9-11H2,4-5H3
Standard InChI Key: RMLGFOIKWNFTJX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
11.2486 3.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2474 2.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9622 2.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6787 2.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6758 3.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9604 3.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9639 1.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2477 0.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2472 0.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9621 -0.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6790 0.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6760 0.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9580 4.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6712 4.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3887 3.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1047 3.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8177 3.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3948 -0.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3975 -1.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1134 -1.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5338 1.2637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5349 -0.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8204 0.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1062 -0.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1051 -1.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8243 -1.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5356 -1.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3909 -1.6222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6762 -1.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8266 -2.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1133 -2.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1156 -3.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 2 0
15 16 1 0
16 17 2 0
8 9 1 0
11 18 1 0
4 5 1 0
18 19 1 0
9 10 2 0
19 20 2 0
2 3 1 0
8 21 1 0
10 11 1 0
5 6 2 0
22 23 2 0
11 12 2 0
23 24 1 0
12 7 1 0
24 25 2 0
3 7 1 0
25 26 1 0
6 1 1 0
26 27 2 0
27 22 1 0
9 22 1 0
6 13 1 0
25 28 1 0
1 2 2 0
28 29 1 0
13 14 1 0
26 30 1 0
3 4 2 0
30 31 1 0
5 15 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.56Molecular Weight (Monoisotopic): 426.2195AlogP: 6.93#Rotatable Bonds: 10Polar Surface Area: 38.69Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.98CX Basic pKa: ┄CX LogP: 7.94CX LogD: 7.93Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: 0.48
References 1. Lin JM, Prakasha Gowda AS, Sharma AK, Amin S.. (2012) In vitro growth inhibition of human cancer cells by novel honokiol analogs., 20 (10): [PMID:22533983 ] [10.1016/j.bmc.2012.03.062 ] 2. Lin D, Yan Z, Chen A, Ye J, Hu A, Liu J, Peng J, Wu X.. (2019) Anti-proliferative activity and structure-activity relationship of honokiol derivatives., 27 (16): [PMID:31278004 ] [10.1016/j.bmc.2019.06.042 ]