3-(1-(2-chlorobenzyl)piperidin-4-yl)-4-phenyl-3,4-dihydroquinazolin-2(1H)-one

ID: ALA201875

PubChem CID: 19423567

Max Phase: Preclinical

Molecular Formula: C26H26ClN3O

Molecular Weight: 431.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccccc2C(c2ccccc2)N1C1CCN(Cc2ccccc2Cl)CC1

Standard InChI:  InChI=1S/C26H26ClN3O/c27-23-12-6-4-10-20(23)18-29-16-14-21(15-17-29)30-25(19-8-2-1-3-9-19)22-11-5-7-13-24(22)28-26(30)31/h1-13,21,25H,14-18H2,(H,28,31)

Standard InChI Key:  CQBYCTWLUKYTPN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    7.9486   -0.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9474   -1.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6622   -2.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6604   -0.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3758   -0.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3792   -1.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0984   -2.0199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8188   -1.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8154   -0.7696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0916   -0.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0870    0.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7981    0.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7939    1.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0767    2.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3621    1.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3698    0.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5344   -2.0132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5286   -0.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2478   -0.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9588   -0.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9605    0.4679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2449    0.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5276    0.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6753    0.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3895    0.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3842   -0.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0975   -0.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8132   -0.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8112    0.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0972    0.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0929    1.7073    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 14 15  1  0
  5  4  1  0
 15 16  2  0
 16 11  1  0
  4  1  2  0
  8 17  2  0
  5 10  1  0
  9 18  1  0
 18 19  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5  6  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 10 11  1  0
 21 24  1  0
 24 25  1  0
 11 12  2  0
 25 26  2  0
  2  3  2  0
 26 27  1  0
 12 13  1  0
 27 28  2  0
  3  6  1  0
 28 29  1  0
 13 14  2  0
 29 30  2  0
 30 25  1  0
  1  2  1  0
 30 31  1  0
M  END

Associated Targets(non-human)

SLC8A1 Sodium/calcium exchanger 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.97Molecular Weight (Monoisotopic): 431.1764AlogP: 5.94#Rotatable Bonds: 4
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.78CX Basic pKa: 7.55CX LogP: 5.22CX LogD: 4.83
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.55Np Likeness Score: -1.05

References

1. Hasegawa H, Muraoka M, Matsui K, Kojima A..  (2006)  A novel class of sodium/calcium exchanger inhibitors: design, synthesis, and structure-activity relationships of 4-phenyl-3-(piperidin-4-yl)-3,4-dihydro-2(1H)-quinazolinone derivatives.,  16  (3): [PMID:16249082] [10.1016/j.bmcl.2005.10.012]

Source