(R)-3-cyclopropylmethyl-19-(1-isothiocyanatoethyl)-15-methoxy-13-oxa-3-azahexacyclo[13.2.2.12,8.01,6.06,14.07,12]icosa-7,9,11,16-tetraen-11-ol

ID: ALA2021332

PubChem CID: 70696006

Max Phase: Preclinical

Molecular Formula: C26H30N2O3S

Molecular Weight: 450.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@]12C=C[C@@]3(CC1[C@@H](C)N=C=S)C1Cc4ccc(O)c5c4C3(CCN1CC1CC1)[C@H]2O5

Standard InChI:  InChI=1S/C26H30N2O3S/c1-15(27-14-32)18-12-24-7-8-26(18,30-2)23-25(24)9-10-28(13-16-3-4-16)20(24)11-17-5-6-19(29)22(31-23)21(17)25/h5-8,15-16,18,20,23,29H,3-4,9-13H2,1-2H3/t15-,18?,20?,23-,24-,25?,26-/m1/s1

Standard InChI Key:  OUKDLWAAMCMZEI-ACQAJGDTSA-N

Molfile:  

     RDKit          2D

 34 40  0  0  0  0  0  0  0  0999 V2000
   -2.7523    6.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0477    5.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4652    5.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4860    4.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7481    6.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4652    7.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8737    6.5206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3266    6.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6137    5.6910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7731    4.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0352    7.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7773    5.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7856    4.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0519    4.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3224    6.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2156    2.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1728    6.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0909    5.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4652    8.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8871    5.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7513    6.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4985    3.2439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9368    2.4310    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6875    5.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2998    6.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0352    8.1715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7773    3.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1989    4.4945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7523    8.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1864    8.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729    2.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9118    4.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0438    2.6886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4406    5.4956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  1  1  0
  6  5  1  0
  3  7  1  0
  8  2  1  0
  9 21  1  0
 10  4  1  0
 11  5  2  0
  2 12  1  6
  4 13  1  0
 14  2  1  0
 15 11  1  0
 16 22  2  0
 17  1  1  0
 18  9  1  0
 19  6  2  0
 20 18  1  0
 21 17  1  0
 27 22  1  0
 23 16  2  0
 24 20  1  0
 25 20  1  0
 26 11  1  0
 27 10  1  0
  4 28  1  6
 29 26  2  0
 30 19  1  0
 31 27  1  0
 32 28  1  0
 27 33  1  6
  6  7  1  0
 14 10  1  0
  9  8  1  0
 15  8  1  0
 13 12  2  0
 29 19  1  0
 24 25  1  0
  3 34  1  1
M  END

Associated Targets(non-human)

OPRM1 Mu opioid receptor (123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.60Molecular Weight (Monoisotopic): 450.1977AlogP: 3.88#Rotatable Bonds: 5
Polar Surface Area: 54.29Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.39CX Basic pKa: 9.59CX LogP: 3.41CX LogD: 1.50
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: 1.42

References

1. Klein P, Nelson WL, Yao YH, Simon EJ..  (1990)  Electrophilic alpha-methylene-gamma-lactone and isothiocyanate opioid ligands related to etorphine.,  33  (8): [PMID:2165166] [10.1021/jm00170a038]

Source