(R)-19-(1-isothiocyanatoethyl)-15-methoxy-3-methyl-13-oxa-3-azahexacyclo[13.2.2.12,8.01,6.06,14.07,12]icosa-7,9,11,16-tetraen-11-ol

ID: ALA2021335

PubChem CID: 70683393

Max Phase: Preclinical

Molecular Formula: C23H26N2O3S

Molecular Weight: 410.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@]12C=C[C@@]3(CC1[C@@H](C)N=C=S)C1Cc4ccc(O)c5c4C3(CCN1C)[C@H]2O5

Standard InChI:  InChI=1S/C23H26N2O3S/c1-13(24-12-29)15-11-21-6-7-23(15,27-3)20-22(21)8-9-25(2)17(21)10-14-4-5-16(26)19(28-20)18(14)22/h4-7,13,15,17,20,26H,8-11H2,1-3H3/t13-,15?,17?,20-,21-,22?,23-/m1/s1

Standard InChI Key:  WTVMVUJOBOGEOT-UCYOIAKYSA-N

Molfile:  

     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
   -3.2060    7.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5018    6.9652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9185    6.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9393    6.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2018    8.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9185    8.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3268    7.7902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7810    7.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2268    5.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4893    8.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2310    6.9819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2393    6.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5060    6.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7768    8.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685    6.9569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6685    4.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6268    7.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9185    9.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9518    4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3893    3.7027    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2060    7.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4893    9.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2310    4.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6518    5.7652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2060    9.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6393    9.8569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3643    6.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0185    4.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3643    6.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6193    3.9979    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8937    6.7687    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  1  1  0
  6  5  1  0
  3  7  1  0
  8  2  1  0
  9  4  1  0
 10  5  2  0
  2 11  1  6
  4 12  1  0
 13  2  1  0
 14 10  1  0
 15 21  1  0
 16 19  2  0
  1 17  1  0
 18  6  2  0
 23 19  1  0
 20 16  2  0
 21 17  1  0
 22 10  1  0
 23  9  1  0
  4 24  1  6
 25 22  2  0
 26 18  1  0
 27 15  1  0
 28 23  1  0
 29 24  1  0
 23 30  1  6
  6  7  1  0
 13  9  1  0
  8 15  1  0
 14  8  1  0
 12 11  2  0
 25 18  1  0
  3 31  1  1
M  END

Associated Targets(non-human)

OPRM1 Mu opioid receptor (123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.54Molecular Weight (Monoisotopic): 410.1664AlogP: 3.10#Rotatable Bonds: 3
Polar Surface Area: 54.29Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.22CX Basic pKa: 9.06CX LogP: 2.80CX LogD: 1.37
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: 1.77

References

1. Klein P, Nelson WL, Yao YH, Simon EJ..  (1990)  Electrophilic alpha-methylene-gamma-lactone and isothiocyanate opioid ligands related to etorphine.,  33  (8): [PMID:2165166] [10.1021/jm00170a038]

Source