The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(-)-(1R,2S,5S)-6-Allyl-2-benzyloxy-8-(2,4-dimethoxybenzyl)-6,8-diazabicyclo[3.2.2]nonane ID: ALA2021503
PubChem CID: 70691858
Max Phase: Preclinical
Molecular Formula: C26H34N2O3
Molecular Weight: 422.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCN1C[C@@H]2[C@@H](COc3ccccc3)CC[C@H]1CN2Cc1ccc(OC)cc1OC
Standard InChI: InChI=1S/C26H34N2O3/c1-4-14-27-18-25-21(19-31-23-8-6-5-7-9-23)10-12-22(27)17-28(25)16-20-11-13-24(29-2)15-26(20)30-3/h4-9,11,13,15,21-22,25H,1,10,12,14,16-19H2,2-3H3/t21-,22+,25-/m1/s1
Standard InChI Key: QQZQNNAGLPTSFB-OTNCWRBYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.5670 -4.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7420 -4.0955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0275 -3.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3130 -4.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0275 -4.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6150 -5.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0275 -5.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2306 -5.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6092 -3.6651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4061 -3.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8244 -4.7216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.4400 -5.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8525 -5.9370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6775 -5.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0900 -5.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9150 -5.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3275 -5.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9150 -6.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0900 -6.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7927 -3.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2093 -4.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5876 -3.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9795 -3.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5669 -2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9794 -1.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8045 -1.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2170 -2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8045 -3.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7419 -2.6666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3294 -1.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2170 -1.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.0420 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5986 -4.5080 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
4 9 1 0
9 10 1 0
10 5 1 0
5 11 1 1
6 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
14 19 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
9 20 1 0
20 21 1 0
21 22 2 0
1 23 1 0
23 24 1 0
23 28 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
24 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
4 33 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.57Molecular Weight (Monoisotopic): 422.2569AlogP: 4.23#Rotatable Bonds: 9Polar Surface Area: 34.17Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.76CX LogP: 4.45CX LogD: 3.93Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -0.20
References 1. Holl R, Schepmann D, Fröhlich R, Grünert R, Bednarski PJ, Wünsch B.. (2009) Dancing of the second aromatic residue around the 6,8-diazabicyclo[3.2.2]nonane framework: influence on sigma receptor affinity and cytotoxicity., 52 (7): [PMID:19243173 ] [10.1021/jm801522j ]